| General Information | |
|---|---|
| ZINC ID | ZINC000043021606 |
| Molecular Weight (Da) | 483 |
| SMILES | CCc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C2CC2)cc1 |
| Molecular Formula | C26Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 135.141 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| LogP | 7.296 |
| Activity (Ki) in nM | 3.9811 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.942 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.38 |
| Ilogp | 4.88 |
| Xlogp3 | 7.2 |
| Wlogp | 5.97 |
| Mlogp | 5.42 |
| Silicos-it log p | 5.77 |
| Consensus log p | 5.85 |
| Esol log s | -7.29 |
| Esol solubility (mg/ml) | 0.0000247 |
| Esol solubility (mol/l) | 0.00000005 |
| Esol class | Poorly sol |
| Ali log s | -8.08 |
| Ali solubility (mg/ml) | 0.00000406 |
| Ali solubility (mol/l) | 8.39E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.63 |
| Silicos-it solubility (mg/ml) | 0.00000113 |
| Silicos-it solubility (mol/l) | 2.33E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.14 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.8 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.876 |
| Logd | 5.07 |
| Logp | 6.554 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | - |
| Ppb | 99.42% |
| Vdss | 1.78 |
| Fu | 1.39% |
| Cyp1a2-inh | 0.086 |
| Cyp1a2-sub | 0.933 |
| Cyp2c19-inh | 0.866 |
| Cyp2c19-sub | 0.755 |
| Cl | 4.652 |
| T12 | 0.012 |
| H-ht | 0.843 |
| Dili | 0.944 |
| Roa | 0.964 |
| Fdamdd | 0.621 |
| Skinsen | 0.05 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.734 |
| Bcf | 2.001 |
| Igc50 | 5.097 |
| Lc50 | 6.144 |
| Lc50dm | 5.913 |
| Nr-ar | 0.019 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.617 |
| Nr-aromatase | 0.949 |
| Nr-er | 0.697 |
| Nr-er-lbd | 0.295 |
| Nr-ppar-gamma | 0.773 |
| Sr-are | 0.889 |
| Sr-atad5 | 0.021 |
| Sr-hse | 0.712 |
| Sr-mmp | 0.951 |
| Sr-p53 | 0.944 |
| Vol | 474.941 |
| Dense | 1.015 |
| Flex | 0.259 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.441 |
| Synth | 2.616 |
| Fsp3 | 0.385 |
| Mce-18 | 66 |
| Natural product-likeness | -1.189 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |