| General Information | |
|---|---|
| ZINC ID | ZINC000043020620 |
| Molecular Weight (Da) | 388 |
| SMILES | CC(C)(C)c1nc2c(n1CC1CC1)CCN(S(=O)(=O)Cc1ccccc1)C2 |
| Molecular Formula | C21N3O2S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 107.135 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| LogP | 3.507 |
| Activity (Ki) in nM | 21.878 |
| Polar Surface Area (PSA) | 63.58 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.82601785 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.57 |
| Ilogp | 3.32 |
| Xlogp3 | 3.08 |
| Wlogp | 3.81 |
| Mlogp | 2.23 |
| Silicos-it log p | 3.12 |
| Consensus log p | 3.11 |
| Esol log s | -4.09 |
| Esol solubility (mg/ml) | 3.16E-02 |
| Esol solubility (mol/l) | 8.15E-05 |
| Esol class | Moderately |
| Ali log s | -4.08 |
| Ali solubility (mg/ml) | 3.20E-02 |
| Ali solubility (mol/l) | 8.27E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -5.57 |
| Silicos-it solubility (mg/ml) | 1.04E-03 |
| Silicos-it solubility (mol/l) | 2.69E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.48 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.73 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.647 |
| Logd | 3.516 |
| Logp | 3.408 |
| F (20%) | 0.004 |
| F (30%) | 0.011 |
| Mdck | 3.45E-05 |
| Ppb | 0.9365 |
| Vdss | 0.803 |
| Fu | 0.0737 |
| Cyp1a2-inh | 0.169 |
| Cyp1a2-sub | 0.542 |
| Cyp2c19-inh | 0.938 |
| Cyp2c19-sub | 0.589 |
| Cl | 8.202 |
| T12 | 0.147 |
| H-ht | 0.796 |
| Dili | 0.826 |
| Roa | 0.206 |
| Fdamdd | 0.921 |
| Skinsen | 0.07 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.886 |
| Bcf | 1.86 |
| Igc50 | 4.438 |
| Lc50 | 5.858 |
| Lc50dm | 4.385 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.084 |
| Nr-aromatase | 0.914 |
| Nr-er | 0.086 |
| Nr-er-lbd | 0.401 |
| Nr-ppar-gamma | 0.075 |
| Sr-are | 0.539 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.491 |
| Sr-mmp | 0.169 |
| Sr-p53 | 0.234 |
| Vol | 393.444 |
| Dense | 0.984 |
| Flex | 21 |
| Nstereo | 0.286 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.789 |
| Fsp3 | 2.703 |
| Mce-18 | 0.571 |
| Natural product-likeness | 59.091 |
| Alarm nmr | -1.376 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |