| General Information | |
|---|---|
| ZINC ID | ZINC000043018620 |
| Molecular Weight (Da) | 419 |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccccc2F)c1-c1ccc(C2CC2)cc1 |
| Molecular Formula | C25F1N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.147 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 5.716 |
| Activity (Ki) in nM | 10.9648 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.064 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.36 |
| Ilogp | 3.61 |
| Xlogp3 | 5.62 |
| Wlogp | 4.97 |
| Mlogp | 4.65 |
| Silicos-it log p | 4.52 |
| Consensus log p | 4.67 |
| Esol log s | -5.99 |
| Esol solubility (mg/ml) | 0.000433 |
| Esol solubility (mol/l) | 0.00000103 |
| Esol class | Moderately |
| Ali log s | -6.44 |
| Ali solubility (mg/ml) | 0.000153 |
| Ali solubility (mol/l) | 0.00000036 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.34 |
| Silicos-it solubility (mg/ml) | 0.0000191 |
| Silicos-it solubility (mol/l) | 4.57E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.86 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.56 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.038 |
| Logd | 4.139 |
| Logp | 5.185 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 97.61% |
| Vdss | 1.405 |
| Fu | 2.00% |
| Cyp1a2-inh | 0.065 |
| Cyp1a2-sub | 0.764 |
| Cyp2c19-inh | 0.845 |
| Cyp2c19-sub | 0.857 |
| Cl | 5.414 |
| T12 | 0.02 |
| H-ht | 0.936 |
| Dili | 0.914 |
| Roa | 0.933 |
| Fdamdd | 0.858 |
| Skinsen | 0.051 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.854 |
| Bcf | 1.677 |
| Igc50 | 4.644 |
| Lc50 | 5.575 |
| Lc50dm | 6.382 |
| Nr-ar | 0.019 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.642 |
| Nr-aromatase | 0.95 |
| Nr-er | 0.721 |
| Nr-er-lbd | 0.021 |
| Nr-ppar-gamma | 0.666 |
| Sr-are | 0.848 |
| Sr-atad5 | 0.039 |
| Sr-hse | 0.333 |
| Sr-mmp | 0.894 |
| Sr-p53 | 0.887 |
| Vol | 433.29 |
| Dense | 0.965 |
| Flex | 0.222 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.635 |
| Synth | 2.473 |
| Fsp3 | 0.36 |
| Mce-18 | 64.235 |
| Natural product-likeness | -1.264 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |