| General Information | |
|---|---|
| ZINC ID | ZINC000043016117 |
| Molecular Weight (Da) | 356 |
| SMILES | COCCS(=O)(=O)N1CCc2c(nc(C(C)(C)C)n2CC2CC2)C1 |
| Molecular Formula | C17N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 93.566 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| LogP | 1.793 |
| Activity (Ki) in nM | 26.915 |
| Polar Surface Area (PSA) | 72.81 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.30607545 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 5 |
| Fraction csp3 | 0.82 |
| Ilogp | 2.89 |
| Xlogp3 | 1.44 |
| Wlogp | 2.41 |
| Mlogp | 0.74 |
| Silicos-it log p | 1.95 |
| Consensus log p | 1.89 |
| Esol log s | -2.64 |
| Esol solubility (mg/ml) | 8.08E-01 |
| Esol solubility (mol/l) | 2.27E-03 |
| Esol class | Soluble |
| Ali log s | -2.57 |
| Ali solubility (mg/ml) | 9.47E-01 |
| Ali solubility (mol/l) | 2.66E-03 |
| Ali class | Soluble |
| Silicos-it logsw | -3.61 |
| Silicos-it solubility (mg/ml) | 8.73E-02 |
| Silicos-it solubility (mol/l) | 2.45E-04 |
| Silicos-it class | Soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.45 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -1.963 |
| Logd | 2.067 |
| Logp | 1.843 |
| F (20%) | 0.42 |
| F (30%) | 0.092 |
| Mdck | 2.71E-05 |
| Ppb | 0.7547 |
| Vdss | 2.277 |
| Fu | 0.3582 |
| Cyp1a2-inh | 0.067 |
| Cyp1a2-sub | 0.316 |
| Cyp2c19-inh | 0.67 |
| Cyp2c19-sub | 0.819 |
| Cl | 6.92 |
| T12 | 0.295 |
| H-ht | 0.898 |
| Dili | 0.404 |
| Roa | 0.322 |
| Fdamdd | 0.884 |
| Skinsen | 0.065 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.885 |
| Bcf | 1.426 |
| Igc50 | 2.79 |
| Lc50 | 4.313 |
| Lc50dm | 3.83 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.049 |
| Nr-aromatase | 0.946 |
| Nr-er | 0.074 |
| Nr-er-lbd | 0.524 |
| Nr-ppar-gamma | 0.029 |
| Sr-are | 0.425 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.42 |
| Sr-mmp | 0.023 |
| Sr-p53 | 0.224 |
| Vol | 349.516 |
| Dense | 1.016 |
| Flex | 15 |
| Nstereo | 0.467 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.782 |
| Fsp3 | 2.963 |
| Mce-18 | 0.824 |
| Natural product-likeness | 50.129 |
| Alarm nmr | -1.41 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |