| General Information | |
|---|---|
| ZINC ID | ZINC000043013845 |
| Molecular Weight (Da) | 596 |
| SMILES | C[C@H](Nc1cc(NC2CCCCCC2)nc(C(F)(F)F)n1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(Br)c1 |
| Molecular Formula | C28Br1Cl1F3N4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 147.866 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| LogP | 9.613 |
| Activity (Ki) in nM | 38.9045 |
| Polar Surface Area (PSA) | 49.84 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.181 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.43 |
| Ilogp | 5.23 |
| Xlogp3 | 9.57 |
| Wlogp | 9.64 |
| Mlogp | 6.51 |
| Silicos-it log p | 7.74 |
| Consensus log p | 7.74 |
| Esol log s | -9.33 |
| Esol solubility (mg/ml) | 0.00000027 |
| Esol solubility (mol/l) | 4.68E-10 |
| Esol class | Poorly sol |
| Ali log s | -10.53 |
| Ali solubility (mg/ml) | 1.76E-08 |
| Ali solubility (mol/l) | 2.96E-11 |
| Ali class | Insoluble |
| Silicos-it logsw | -11.45 |
| Silicos-it solubility (mg/ml) | 2.10E-09 |
| Silicos-it solubility (mol/l) | 3.53E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.14 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.758 |
| Logd | 4.941 |
| Logp | 7.71 |
| F (20%) | 0.005 |
| F (30%) | 0.006 |
| Mdck | - |
| Ppb | 99.85% |
| Vdss | 4.766 |
| Fu | 0.30% |
| Cyp1a2-inh | 0.279 |
| Cyp1a2-sub | 0.696 |
| Cyp2c19-inh | 0.785 |
| Cyp2c19-sub | 0.049 |
| Cl | 3.439 |
| T12 | 0.005 |
| H-ht | 0.591 |
| Dili | 0.85 |
| Roa | 0.984 |
| Fdamdd | 0.922 |
| Skinsen | 0.036 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.857 |
| Bcf | 2.08 |
| Igc50 | 5.343 |
| Lc50 | 6.592 |
| Lc50dm | 6.625 |
| Nr-ar | 0.071 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.754 |
| Nr-aromatase | 0.859 |
| Nr-er | 0.603 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.033 |
| Sr-are | 0.584 |
| Sr-atad5 | 0.047 |
| Sr-hse | 0.758 |
| Sr-mmp | 0.884 |
| Sr-p53 | 0.607 |
| Vol | 531.574 |
| Dense | 1.118 |
| Flex | 0.308 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.27 |
| Synth | 3.885 |
| Fsp3 | 0.429 |
| Mce-18 | 83.75 |
| Natural product-likeness | -0.722 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |