| General Information | |
|---|---|
| ZINC ID | ZINC000042888195 |
| Molecular Weight (Da) | 573 |
| SMILES | O=C([C@@H]1C[C@H]1c1ccc(C(F)(F)F)cc1)N1CCN(S(=O)(=O)c2cc(-c3cn[nH]c3)cc(C(F)(F)F)c2)CC1 |
| Molecular Formula | C25F6N4O3S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 131.62 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| LogP | 3.582 |
| Activity (Ki) in nM | 8.9125 |
| Polar Surface Area (PSA) | 94.75 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.964 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.36 |
| Ilogp | 3.26 |
| Xlogp3 | 3.88 |
| Wlogp | 7.37 |
| Mlogp | 3.39 |
| Silicos-it log p | 4.45 |
| Consensus log p | 4.47 |
| Esol log s | -5.63 |
| Esol solubility (mg/ml) | 0.00135 |
| Esol solubility (mol/l) | 0.00000235 |
| Esol class | Moderately |
| Ali log s | -5.57 |
| Ali solubility (mg/ml) | 0.00155 |
| Ali solubility (mol/l) | 0.00000271 |
| Ali class | Moderately |
| Silicos-it logsw | -7.8 |
| Silicos-it solubility (mg/ml) | 0.00000905 |
| Silicos-it solubility (mol/l) | 1.58E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.04 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.31 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.322 |
| Logd | 4.274 |
| Logp | 4.799 |
| F (20%) | 0.004 |
| F (30%) | 0.008 |
| Mdck | - |
| Ppb | 98.03% |
| Vdss | 3.106 |
| Fu | 1.43% |
| Cyp1a2-inh | 0.329 |
| Cyp1a2-sub | 0.326 |
| Cyp2c19-inh | 0.861 |
| Cyp2c19-sub | 0.197 |
| Cl | 4.921 |
| T12 | 0.014 |
| H-ht | 0.99 |
| Dili | 0.983 |
| Roa | 0.878 |
| Fdamdd | 0.933 |
| Skinsen | 0.012 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.736 |
| Bcf | 1.53 |
| Igc50 | 4.009 |
| Lc50 | 5.6 |
| Lc50dm | 6.316 |
| Nr-ar | 0.033 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.185 |
| Nr-aromatase | 0.881 |
| Nr-er | 0.327 |
| Nr-er-lbd | 0.048 |
| Nr-ppar-gamma | 0.104 |
| Sr-are | 0.865 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.019 |
| Sr-mmp | 0.692 |
| Sr-p53 | 0.409 |
| Vol | 499.718 |
| Dense | 1.145 |
| Flex | 0.276 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.448 |
| Synth | 3.517 |
| Fsp3 | 0.36 |
| Mce-18 | 119.412 |
| Natural product-likeness | -1.544 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |