| General Information | |
|---|---|
| ZINC ID | ZINC000042887583 |
| Molecular Weight (Da) | 534 |
| SMILES | Cc1c(C(=O)NCNC(=O)CC2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C26Cl3N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 140.201 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| LogP | 7.195 |
| Activity (Ki) in nM | 46.7735 |
| Polar Surface Area (PSA) | 76.02 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.035 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.35 |
| Ilogp | 4.87 |
| Xlogp3 | 7.5 |
| Wlogp | 6.58 |
| Mlogp | 5 |
| Silicos-it log p | 6.14 |
| Consensus log p | 6.02 |
| Esol log s | -7.64 |
| Esol solubility (mg/ml) | 0.0000122 |
| Esol solubility (mol/l) | 2.29E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.93 |
| Ali solubility (mg/ml) | 0.00000062 |
| Ali solubility (mol/l) | 1.17E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.71 |
| Silicos-it solubility (mg/ml) | 0.0000001 |
| Silicos-it solubility (mol/l) | 1.96E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.23 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.74 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.759 |
| Logd | 4.588 |
| Logp | 6.391 |
| F (20%) | 0.001 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 99.61% |
| Vdss | 1.162 |
| Fu | 1.86% |
| Cyp1a2-inh | 0.152 |
| Cyp1a2-sub | 0.384 |
| Cyp2c19-inh | 0.879 |
| Cyp2c19-sub | 0.422 |
| Cl | 7.934 |
| T12 | 0.039 |
| H-ht | 0.481 |
| Dili | 0.719 |
| Roa | 0.324 |
| Fdamdd | 0.819 |
| Skinsen | 0.497 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.121 |
| Bcf | 2.24 |
| Igc50 | 5.244 |
| Lc50 | 5.857 |
| Lc50dm | 5.689 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.736 |
| Nr-aromatase | 0.605 |
| Nr-er | 0.341 |
| Nr-er-lbd | 0.003 |
| Nr-ppar-gamma | 0.014 |
| Sr-are | 0.835 |
| Sr-atad5 | 0.043 |
| Sr-hse | 0.062 |
| Sr-mmp | 0.648 |
| Sr-p53 | 0.722 |
| Vol | 504.862 |
| Dense | 1.054 |
| Flex | 0.36 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.337 |
| Synth | 2.593 |
| Fsp3 | 0.346 |
| Mce-18 | 56.229 |
| Natural product-likeness | -1.108 |
| Alarm nmr | 0 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |