| General Information | |
|---|---|
| ZINC ID | ZINC000040976026 |
| Molecular Weight (Da) | 462 |
| SMILES | Cc1c(C2=NC(=O)C(C)(C)N2C)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C22Cl3N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.785 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| LogP | 6.906 |
| Activity (Ki) in nM | 54.9541 |
| Polar Surface Area (PSA) | 50.49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.932 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.93 |
| Xlogp3 | 5.85 |
| Wlogp | 5.04 |
| Mlogp | 4.6 |
| Silicos-it log p | 6.2 |
| Consensus log p | 5.12 |
| Esol log s | -6.61 |
| Esol solubility (mg/ml) | 0.000113 |
| Esol solubility (mol/l) | 0.00000024 |
| Esol class | Poorly sol |
| Ali log s | -6.68 |
| Ali solubility (mg/ml) | 0.000096 |
| Ali solubility (mol/l) | 0.0000002 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.78 |
| Silicos-it solubility (mg/ml) | 0.00000076 |
| Silicos-it solubility (mol/l) | 1.66E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.96 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.63 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.677 |
| Logd | 4.656 |
| Logp | 5.402 |
| F (20%) | 0.002 |
| F (30%) | 0.007 |
| Mdck | - |
| Ppb | 95.88% |
| Vdss | 0.67 |
| Fu | 2.39% |
| Cyp1a2-inh | 0.236 |
| Cyp1a2-sub | 0.954 |
| Cyp2c19-inh | 0.911 |
| Cyp2c19-sub | 0.925 |
| Cl | 3.465 |
| T12 | 0.074 |
| H-ht | 0.256 |
| Dili | 0.953 |
| Roa | 0.386 |
| Fdamdd | 0.785 |
| Skinsen | 0.028 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.276 |
| Bcf | 3.83 |
| Igc50 | 4.966 |
| Lc50 | 6.828 |
| Lc50dm | 5.908 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.791 |
| Nr-aromatase | 0.956 |
| Nr-er | 0.868 |
| Nr-er-lbd | 0.305 |
| Nr-ppar-gamma | 0.05 |
| Sr-are | 0.867 |
| Sr-atad5 | 0.02 |
| Sr-hse | 0.016 |
| Sr-mmp | 0.923 |
| Sr-p53 | 0.924 |
| Vol | 426.888 |
| Dense | 1.078 |
| Flex | 0.13 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.495 |
| Synth | 2.794 |
| Fsp3 | 0.227 |
| Mce-18 | 56 |
| Natural product-likeness | -0.912 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |