| General Information | |
|---|---|
| ZINC ID | ZINC000040938160 |
| Molecular Weight (Da) | 402 |
| SMILES | CC(C)CCNC(=O)c1ccc2c(c1)N=C(c1ccccn1)c1ccccc1S2 |
| Molecular Formula | C24N3O1S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.361 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| LogP | 5.426 |
| Activity (Ki) in nM | 1.5849 |
| Polar Surface Area (PSA) | 79.65 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.924 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.21 |
| Ilogp | 3.13 |
| Xlogp3 | 5.37 |
| Wlogp | 5.11 |
| Mlogp | 3.7 |
| Silicos-it log p | 6.03 |
| Consensus log p | 4.67 |
| Esol log s | -5.78 |
| Esol solubility (mg/ml) | 0.000673 |
| Esol solubility (mol/l) | 0.00000168 |
| Esol class | Moderately |
| Ali log s | -6.8 |
| Ali solubility (mg/ml) | 0.0000642 |
| Ali solubility (mol/l) | 0.00000016 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.03 |
| Silicos-it solubility (mg/ml) | 0.00000037 |
| Silicos-it solubility (mol/l) | 9.38E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.94 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.74 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.554 |
| Logd | 4.062 |
| Logp | 4.445 |
| F (20%) | 0.009 |
| F (30%) | 0.458 |
| Mdck | - |
| Ppb | 97.30% |
| Vdss | 1.605 |
| Fu | 0.95% |
| Cyp1a2-inh | 0.715 |
| Cyp1a2-sub | 0.826 |
| Cyp2c19-inh | 0.931 |
| Cyp2c19-sub | 0.503 |
| Cl | 1.303 |
| T12 | 0.029 |
| H-ht | 0.469 |
| Dili | 0.981 |
| Roa | 0.052 |
| Fdamdd | 0.984 |
| Skinsen | 0.064 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.877 |
| Bcf | 2.088 |
| Igc50 | 5.223 |
| Lc50 | 5.548 |
| Lc50dm | 5.293 |
| Nr-ar | 0.072 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.876 |
| Nr-aromatase | 0.915 |
| Nr-er | 0.74 |
| Nr-er-lbd | 0.017 |
| Nr-ppar-gamma | 0.118 |
| Sr-are | 0.652 |
| Sr-atad5 | 0.713 |
| Sr-hse | 0.061 |
| Sr-mmp | 0.803 |
| Sr-p53 | 0.881 |
| Vol | 420.723 |
| Dense | 0.954 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.481 |
| Synth | 2.492 |
| Fsp3 | 0.208 |
| Mce-18 | 42 |
| Natural product-likeness | -0.97 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |