| General Information | |
|---|---|
| ZINC ID | ZINC000040898177 |
| Molecular Weight (Da) | 503 |
| SMILES | C[C@H](CO)NC(=O)CCC/C=CC/C=CC/C=CC/C=CCCCCc1ccccc1Br |
| Molecular Formula | C28Br1N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 145.101 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| LogP | 7.636 |
| Activity (Ki) in nM | 169.824 |
| Polar Surface Area (PSA) | 49.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.12040317 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.46 |
| Ilogp | 3.97 |
| Xlogp3 | 4.81 |
| Wlogp | 7.22 |
| Mlogp | 3.21 |
| Silicos-it log p | 4.72 |
| Consensus log p | 4.29 |
| Esol log s | -5.51 |
| Esol solubility (mg/ml) | 0.00127 |
| Esol solubility (mol/l) | 0.00000306 |
| Esol class | Moderately |
| Ali log s | -5.89 |
| Ali solubility (mg/ml) | 0.000538 |
| Ali solubility (mol/l) | 0.0000013 |
| Ali class | Moderately |
| Silicos-it logsw | -7.57 |
| Silicos-it solubility (mg/ml) | 0.000011 |
| Silicos-it solubility (mol/l) | 2.67E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.41 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.84 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.833 |
| Logd | 3.621 |
| Logp | 3.304 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 100.31% |
| Vdss | 2.199 |
| Fu | 1.68% |
| Cyp1a2-inh | 0.356 |
| Cyp1a2-sub | 0.748 |
| Cyp2c19-inh | 0.809 |
| Cyp2c19-sub | 0.067 |
| Cl | 3.147 |
| T12 | 0.949 |
| H-ht | 0.433 |
| Dili | 0.033 |
| Roa | 0.004 |
| Fdamdd | 0.417 |
| Skinsen | 0.967 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.792 |
| Bcf | 1.364 |
| Igc50 | 5.206 |
| Lc50 | 2.592 |
| Lc50dm | 4.365 |
| Nr-ar | 0.019 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.004 |
| Nr-aromatase | 0.51 |
| Nr-er | 0.062 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.873 |
| Sr-are | 0.681 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.94 |
| Sr-mmp | 0.498 |
| Sr-p53 | 0.14 |
| Vol | 511.057 |
| Dense | 0.981 |
| Flex | 1.636 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.175 |
| Synth | 3.341 |
| Fsp3 | 0.464 |
| Mce-18 | 14 |
| Natural product-likeness | 0.25 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |