| General Information | |
|---|---|
| ZINC ID | ZINC000040892195 |
| Molecular Weight (Da) | 451 |
| SMILES | CC(C)NC(=O)N1CCN([C@@H](c2ccc(Br)cc2)c2ccccc2Cl)CC1 |
| Molecular Formula | C21Br1Cl1N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 114.77 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| LogP | 5.587 |
| Activity (Ki) in nM | 776.247 |
| Polar Surface Area (PSA) | 35.58 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.10377144 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.38 |
| Ilogp | 4.3 |
| Xlogp3 | 4.67 |
| Wlogp | 3.84 |
| Mlogp | 4.17 |
| Silicos-it log p | 4.15 |
| Consensus log p | 4.23 |
| Esol log s | -5.51 |
| Esol solubility (mg/ml) | 0.00139 |
| Esol solubility (mol/l) | 0.00000309 |
| Esol class | Moderately |
| Ali log s | -5.14 |
| Ali solubility (mg/ml) | 0.00323 |
| Ali solubility (mol/l) | 0.00000717 |
| Ali class | Moderately |
| Silicos-it logsw | -6.91 |
| Silicos-it solubility (mg/ml) | 0.0000555 |
| Silicos-it solubility (mol/l) | 0.00000012 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.73 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.36 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.89 |
| Logd | 4.134 |
| Logp | 4.58 |
| F (20%) | 0.002 |
| F (30%) | 0.556 |
| Mdck | - |
| Ppb | 96.93% |
| Vdss | 1.58 |
| Fu | 1.51% |
| Cyp1a2-inh | 0.158 |
| Cyp1a2-sub | 0.315 |
| Cyp2c19-inh | 0.954 |
| Cyp2c19-sub | 0.934 |
| Cl | 2.752 |
| T12 | 0.037 |
| H-ht | 0.751 |
| Dili | 0.512 |
| Roa | 0.084 |
| Fdamdd | 0.496 |
| Skinsen | 0.039 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.119 |
| Bcf | 1.15 |
| Igc50 | 3.919 |
| Lc50 | 5.487 |
| Lc50dm | 4.114 |
| Nr-ar | 0.036 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.05 |
| Nr-aromatase | 0.01 |
| Nr-er | 0.31 |
| Nr-er-lbd | 0.293 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.219 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.006 |
| Sr-mmp | 0.459 |
| Sr-p53 | 0.142 |
| Vol | 403.923 |
| Dense | 1.112 |
| Flex | 0.316 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.717 |
| Synth | 2.574 |
| Fsp3 | 0.381 |
| Mce-18 | 58.966 |
| Natural product-likeness | -1.605 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |