| General Information | |
|---|---|
| ZINC ID | ZINC000040866551 |
| Molecular Weight (Da) | 530 |
| SMILES | CCC/C=C/c1ccc(-c2c(C)c(C(=O)NN3C[C@H]4CCC[C@H]4C3)nn2-c2ccc(Cl)cc2Cl)s1 |
| Molecular Formula | C27Cl2N4O1S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 146.198 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| LogP | 8.198 |
| Activity (Ki) in nM | 5370.318 |
| Polar Surface Area (PSA) | 78.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.148 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.41 |
| Ilogp | 5.39 |
| Xlogp3 | 8.07 |
| Wlogp | 6.92 |
| Mlogp | 5.58 |
| Silicos-it log p | 7.05 |
| Consensus log p | 6.6 |
| Esol log s | -8.02 |
| Esol solubility (mg/ml) | 0.00000509 |
| Esol solubility (mol/l) | 9.61E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.57 |
| Ali solubility (mg/ml) | 0.00000014 |
| Ali solubility (mol/l) | 2.68E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.22 |
| Silicos-it solubility (mg/ml) | 0.00000318 |
| Silicos-it solubility (mol/l) | 6.01E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.8 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.04 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.516 |
| Logd | 5.511 |
| Logp | 6.697 |
| F (20%) | 0.014 |
| F (30%) | 0.462 |
| Mdck | 6.11E-06 |
| Ppb | 1.0139 |
| Vdss | 2.178 |
| Fu | 0.0144 |
| Cyp1a2-inh | 0.19 |
| Cyp1a2-sub | 0.915 |
| Cyp2c19-inh | 0.933 |
| Cyp2c19-sub | 0.862 |
| Cl | 4.054 |
| T12 | 0.013 |
| H-ht | 0.994 |
| Dili | 0.979 |
| Roa | 0.44 |
| Fdamdd | 0.556 |
| Skinsen | 0.43 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.55 |
| Bcf | 1.65 |
| Igc50 | 5.364 |
| Lc50 | 6.47 |
| Lc50dm | 6.347 |
| Nr-ar | 0.013 |
| Nr-ar-lbd | 0.822 |
| Nr-ahr | 0.974 |
| Nr-aromatase | 0.936 |
| Nr-er | 0.956 |
| Nr-er-lbd | 0.475 |
| Nr-ppar-gamma | 0.957 |
| Sr-are | 0.979 |
| Sr-atad5 | 0.937 |
| Sr-hse | 0.828 |
| Sr-mmp | 0.986 |
| Sr-p53 | 0.99 |
| Vol | 510.746 |
| Dense | 1.034 |
| Flex | 0.296 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.347 |
| Synth | 3.801 |
| Fsp3 | 0.407 |
| Mce-18 | 94.316 |
| Natural product-likeness | -0.94 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |