| General Information | |
|---|---|
| ZINC ID | ZINC000040864143 |
| Molecular Weight (Da) | 490 |
| SMILES | CCCC[C@H](C)c1nnc(-c2nc(-c3ccc(Cl)cc3Cl)n(-c3ccc(Cl)cc3)c2C)o1 |
| Molecular Formula | C24Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.45 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 8.005 |
| Activity (Ki) in nM | 12.8825 |
| Polar Surface Area (PSA) | 56.74 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.005 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.29 |
| Ilogp | 4.77 |
| Xlogp3 | 7.75 |
| Wlogp | 8.15 |
| Mlogp | 5.65 |
| Silicos-it log p | 7.5 |
| Consensus log p | 6.76 |
| Esol log s | -7.81 |
| Esol solubility (mg/ml) | 0.00000765 |
| Esol solubility (mol/l) | 1.56E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.78 |
| Ali solubility (mg/ml) | 0.0000008 |
| Ali solubility (mol/l) | 1.64E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.54 |
| Silicos-it solubility (mg/ml) | 1.43E-08 |
| Silicos-it solubility (mol/l) | 2.92E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.79 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.117 |
| Logd | 5.194 |
| Logp | 6.87 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 99.72% |
| Vdss | 3.665 |
| Fu | 1.98% |
| Cyp1a2-inh | 0.595 |
| Cyp1a2-sub | 0.577 |
| Cyp2c19-inh | 0.774 |
| Cyp2c19-sub | 0.069 |
| Cl | 2.822 |
| T12 | 0.021 |
| H-ht | 0.264 |
| Dili | 0.94 |
| Roa | 0.359 |
| Fdamdd | 0.891 |
| Skinsen | 0.03 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.818 |
| Bcf | 3.786 |
| Igc50 | 5.264 |
| Lc50 | 6.458 |
| Lc50dm | 6.452 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.036 |
| Nr-ahr | 0.103 |
| Nr-aromatase | 0.945 |
| Nr-er | 0.79 |
| Nr-er-lbd | 0.316 |
| Nr-ppar-gamma | 0.023 |
| Sr-are | 0.951 |
| Sr-atad5 | 0.212 |
| Sr-hse | 0.19 |
| Sr-mmp | 0.849 |
| Sr-p53 | 0.847 |
| Vol | 461.48 |
| Dense | 1.058 |
| Flex | 0.318 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.263 |
| Synth | 3.109 |
| Fsp3 | 0.292 |
| Mce-18 | 48 |
| Natural product-likeness | -1.091 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |