| General Information | |
|---|---|
| ZINC ID | ZINC000040862546 |
| Molecular Weight (Da) | 436 |
| SMILES | Cc1ccccc1-c1nnc(NC(=O)C(C)(C)S(=O)(=O)c2ccc(Cl)cc2)s1 |
| Molecular Formula | C19Cl1N3O3S2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.901 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 4.338 |
| Activity (Ki) in nM | 190.546 |
| Polar Surface Area (PSA) | 125.64 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.13240921 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.21 |
| Ilogp | 2.2 |
| Xlogp3 | 4.64 |
| Wlogp | 5.25 |
| Mlogp | 3.19 |
| Silicos-it log p | 4.51 |
| Consensus log p | 3.96 |
| Esol log s | -5.52 |
| Esol solubility (mg/ml) | 0.00132 |
| Esol solubility (mol/l) | 0.00000302 |
| Esol class | Moderately |
| Ali log s | -7 |
| Ali solubility (mg/ml) | 0.0000431 |
| Ali solubility (mol/l) | 0.00000009 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.6 |
| Silicos-it solubility (mg/ml) | 0.000011 |
| Silicos-it solubility (mol/l) | 2.53E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.66 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.51 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.107 |
| Logd | 3.847 |
| Logp | 4.088 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 2.31E-05 |
| Ppb | 0.9755 |
| Vdss | 0.351 |
| Fu | 0.0165 |
| Cyp1a2-inh | 0.73 |
| Cyp1a2-sub | 0.87 |
| Cyp2c19-inh | 0.964 |
| Cyp2c19-sub | 0.241 |
| Cl | 1.115 |
| T12 | 0.024 |
| H-ht | 0.958 |
| Dili | 0.992 |
| Roa | 0.046 |
| Fdamdd | 0.03 |
| Skinsen | 0.029 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.221 |
| Bcf | 0.648 |
| Igc50 | 2.803 |
| Lc50 | 3.501 |
| Lc50dm | 4.667 |
| Nr-ar | 0.078 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.434 |
| Nr-aromatase | 0.037 |
| Nr-er | 0.658 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.409 |
| Sr-are | 0.75 |
| Sr-atad5 | 0.04 |
| Sr-hse | 0.008 |
| Sr-mmp | 0.85 |
| Sr-p53 | 0.017 |
| Vol | 399.373 |
| Dense | 1.089 |
| Flex | 0.238 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.674 |
| Synth | 2.951 |
| Fsp3 | 0.211 |
| Mce-18 | 22 |
| Natural product-likeness | -1.348 |
| Alarm nmr | 5 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |