| General Information | |
|---|---|
| ZINC ID | ZINC000040423512 |
| Molecular Weight (Da) | 446 |
| SMILES | O=C(NC1CCCCC1)N1CCN([C@@H](c2ccc(Cl)cc2)c2ccccc2Cl)CC1 |
| Molecular Formula | C24Cl2N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.799 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| LogP | 6.635 |
| Activity (Ki) in nM | 72.4436 |
| Polar Surface Area (PSA) | 35.58 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.06 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.46 |
| Ilogp | 4.57 |
| Xlogp3 | 5.62 |
| Wlogp | 4.66 |
| Mlogp | 4.69 |
| Silicos-it log p | 4.66 |
| Consensus log p | 4.84 |
| Esol log s | -6.05 |
| Esol solubility (mg/ml) | 0.000399 |
| Esol solubility (mol/l) | 0.00000089 |
| Esol class | Poorly sol |
| Ali log s | -6.13 |
| Ali solubility (mg/ml) | 0.000331 |
| Ali solubility (mol/l) | 0.00000074 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.29 |
| Silicos-it solubility (mg/ml) | 0.0000228 |
| Silicos-it solubility (mol/l) | 5.11E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.03 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.53 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.809 |
| Logd | 4.533 |
| Logp | 5.477 |
| F (20%) | 0.007 |
| F (30%) | 0.006 |
| Mdck | - |
| Ppb | 97.23% |
| Vdss | 1.561 |
| Fu | 0.94% |
| Cyp1a2-inh | 0.203 |
| Cyp1a2-sub | 0.917 |
| Cyp2c19-inh | 0.891 |
| Cyp2c19-sub | 0.886 |
| Cl | 5.384 |
| T12 | 0.015 |
| H-ht | 0.954 |
| Dili | 0.693 |
| Roa | 0.169 |
| Fdamdd | 0.87 |
| Skinsen | 0.066 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.729 |
| Bcf | 0.889 |
| Igc50 | 4.624 |
| Lc50 | 5.989 |
| Lc50dm | 3.859 |
| Nr-ar | 0.028 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.085 |
| Nr-aromatase | 0.459 |
| Nr-er | 0.35 |
| Nr-er-lbd | 0.025 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.597 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.102 |
| Sr-mmp | 0.657 |
| Sr-p53 | 0.735 |
| Vol | 443.182 |
| Dense | 1.004 |
| Flex | 0.24 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.65 |
| Synth | 2.596 |
| Fsp3 | 0.458 |
| Mce-18 | 75 |
| Natural product-likeness | -1.48 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |