| General Information | |
|---|---|
| ZINC ID | ZINC000040421463 |
| Molecular Weight (Da) | 476 |
| SMILES | CCc1c(-c2nnc(C(C)(C)C)o2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C23Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.027 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 8.003 |
| Activity (Ki) in nM | 2344.229 |
| Polar Surface Area (PSA) | 56.74 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.927 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.26 |
| Ilogp | 4.38 |
| Xlogp3 | 7.47 |
| Wlogp | 7.41 |
| Mlogp | 5.58 |
| Silicos-it log p | 6.95 |
| Consensus log p | 6.36 |
| Esol log s | -7.69 |
| Esol solubility (mg/ml) | 0.00000969 |
| Esol solubility (mol/l) | 2.04E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.49 |
| Ali solubility (mg/ml) | 0.00000152 |
| Ali solubility (mol/l) | 3.20E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.13 |
| Silicos-it solubility (mg/ml) | 3.54E-08 |
| Silicos-it solubility (mol/l) | 7.43E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.9 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.77 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.096 |
| Logd | 5.319 |
| Logp | 6.612 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 8.10E-06 |
| Ppb | 0.9949 |
| Vdss | 4.653 |
| Fu | 0.0225 |
| Cyp1a2-inh | 0.29 |
| Cyp1a2-sub | 0.763 |
| Cyp2c19-inh | 0.844 |
| Cyp2c19-sub | 0.075 |
| Cl | 3.325 |
| T12 | 0.015 |
| H-ht | 0.156 |
| Dili | 0.978 |
| Roa | 0.225 |
| Fdamdd | 0.252 |
| Skinsen | 0.037 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.567 |
| Bcf | 3.105 |
| Igc50 | 5.125 |
| Lc50 | 6.457 |
| Lc50dm | 5.335 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.052 |
| Nr-ahr | 0.089 |
| Nr-aromatase | 0.964 |
| Nr-er | 0.892 |
| Nr-er-lbd | 0.555 |
| Nr-ppar-gamma | 0.672 |
| Sr-are | 0.924 |
| Sr-atad5 | 0.016 |
| Sr-hse | 0.291 |
| Sr-mmp | 0.957 |
| Sr-p53 | 0.901 |
| Vol | 444.184 |
| Dense | 1.067 |
| Flex | 0.227 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.308 |
| Synth | 2.634 |
| Fsp3 | 0.261 |
| Mce-18 | 26 |
| Natural product-likeness | -1.316 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |