| General Information | |
|---|---|
| ZINC ID | ZINC000040412257 |
| Molecular Weight (Da) | 358 |
| SMILES | O=C1NCCc2c1nn(-c1ccccc1Cl)c2-c1ccc(Cl)cc1 |
| Molecular Formula | C18Cl2N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 95.684 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| LogP | 4.573 |
| Activity (Ki) in nM | 61.6595 |
| Polar Surface Area (PSA) | 46.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.961 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.11 |
| Ilogp | 2.68 |
| Xlogp3 | 4.45 |
| Wlogp | 3.75 |
| Mlogp | 3.76 |
| Silicos-it log p | 4.35 |
| Consensus log p | 3.8 |
| Esol log s | -5.26 |
| Esol solubility (mg/ml) | 0.00198 |
| Esol solubility (mol/l) | 0.00000554 |
| Esol class | Moderately |
| Ali log s | -5.15 |
| Ali solubility (mg/ml) | 0.00251 |
| Ali solubility (mol/l) | 0.00000701 |
| Ali class | Moderately |
| Silicos-it logsw | -7.4 |
| Silicos-it solubility (mg/ml) | 0.0000142 |
| Silicos-it solubility (mol/l) | 3.97E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.33 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.79 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.475 |
| Logd | 4.034 |
| Logp | 4.419 |
| F (20%) | 0.001 |
| F (30%) | 0.022 |
| Mdck | - |
| Ppb | 96.92% |
| Vdss | 1.038 |
| Fu | 2.14% |
| Cyp1a2-inh | 0.89 |
| Cyp1a2-sub | 0.21 |
| Cyp2c19-inh | 0.961 |
| Cyp2c19-sub | 0.237 |
| Cl | 4.594 |
| T12 | 0.096 |
| H-ht | 0.538 |
| Dili | 0.95 |
| Roa | 0.616 |
| Fdamdd | 0.669 |
| Skinsen | 0.079 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.233 |
| Bcf | 1.785 |
| Igc50 | 4.465 |
| Lc50 | 5.715 |
| Lc50dm | 5.479 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.025 |
| Nr-ahr | 0.919 |
| Nr-aromatase | 0.93 |
| Nr-er | 0.842 |
| Nr-er-lbd | 0.077 |
| Nr-ppar-gamma | 0.754 |
| Sr-are | 0.887 |
| Sr-atad5 | 0.766 |
| Sr-hse | 0.096 |
| Sr-mmp | 0.717 |
| Sr-p53 | 0.933 |
| Vol | 334.133 |
| Dense | 1.069 |
| Flex | 0.087 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.749 |
| Synth | 2.361 |
| Fsp3 | 0.111 |
| Mce-18 | 46.2 |
| Natural product-likeness | -0.887 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |