| General Information | |
|---|---|
| ZINC ID | ZINC000040410583 |
| Molecular Weight (Da) | 488 |
| SMILES | CC(C)(C)c1nnc(-c2nc(-c3ccc(Cl)cc3Cl)n(-c3ccc(Cl)cc3)c2C2CC2)o1 |
| Molecular Formula | C24Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.184 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| LogP | 7.811 |
| Activity (Ki) in nM | 79.4328 |
| Polar Surface Area (PSA) | 56.74 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.891 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.29 |
| Ilogp | 4.43 |
| Xlogp3 | 7.03 |
| Wlogp | 7.66 |
| Mlogp | 5.65 |
| Silicos-it log p | 6.98 |
| Consensus log p | 6.35 |
| Esol log s | -7.47 |
| Esol solubility (mg/ml) | 0.0000165 |
| Esol solubility (mol/l) | 3.37E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.04 |
| Ali solubility (mg/ml) | 0.00000447 |
| Ali solubility (mol/l) | 9.17E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.92 |
| Silicos-it solubility (mg/ml) | 5.82E-08 |
| Silicos-it solubility (mol/l) | 1.19E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.28 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.93 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.902 |
| Logd | 5.076 |
| Logp | 6.523 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 99.71% |
| Vdss | 2.949 |
| Fu | 1.56% |
| Cyp1a2-inh | 0.181 |
| Cyp1a2-sub | 0.804 |
| Cyp2c19-inh | 0.568 |
| Cyp2c19-sub | 0.097 |
| Cl | 1.823 |
| T12 | 0.021 |
| H-ht | 0.262 |
| Dili | 0.937 |
| Roa | 0.843 |
| Fdamdd | 0.938 |
| Skinsen | 0.025 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.76 |
| Bcf | 3.758 |
| Igc50 | 5.169 |
| Lc50 | 6.401 |
| Lc50dm | 5.871 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.149 |
| Nr-ahr | 0.091 |
| Nr-aromatase | 0.974 |
| Nr-er | 0.817 |
| Nr-er-lbd | 0.309 |
| Nr-ppar-gamma | 0.071 |
| Sr-are | 0.931 |
| Sr-atad5 | 0.02 |
| Sr-hse | 0.158 |
| Sr-mmp | 0.901 |
| Sr-p53 | 0.833 |
| Vol | 452.924 |
| Dense | 1.073 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.295 |
| Synth | 2.767 |
| Fsp3 | 0.292 |
| Mce-18 | 65.806 |
| Natural product-likeness | -1.275 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |