| General Information | |
|---|---|
| ZINC ID | ZINC000040404638 |
| Molecular Weight (Da) | 439 |
| SMILES | C[C@@H](NS(=O)(=O)Cc1ccccc1)[C@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C24Cl1N2O2S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.443 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| LogP | 5.381 |
| Activity (Ki) in nM | 20.893 |
| Polar Surface Area (PSA) | 78.34 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.005 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.21 |
| Ilogp | 2.89 |
| Xlogp3 | 5.31 |
| Wlogp | 5.97 |
| Mlogp | 3.83 |
| Silicos-it log p | 5.24 |
| Consensus log p | 4.65 |
| Esol log s | -5.82 |
| Esol solubility (mg/ml) | 0.00066 |
| Esol solubility (mol/l) | 0.0000015 |
| Esol class | Moderately |
| Ali log s | -6.71 |
| Ali solubility (mg/ml) | 0.0000863 |
| Ali solubility (mol/l) | 0.00000019 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.29 |
| Silicos-it solubility (mg/ml) | 0.00000022 |
| Silicos-it solubility (mol/l) | 5.13E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.21 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.05 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.574 |
| Logd | 4.27 |
| Logp | 5.515 |
| F (20%) | 0.122 |
| F (30%) | 0.023 |
| Mdck | - |
| Ppb | 100.26% |
| Vdss | 0.285 |
| Fu | 0.50% |
| Cyp1a2-inh | 0.636 |
| Cyp1a2-sub | 0.511 |
| Cyp2c19-inh | 0.944 |
| Cyp2c19-sub | 0.175 |
| Cl | 5.126 |
| T12 | 0.108 |
| H-ht | 0.821 |
| Dili | 0.981 |
| Roa | 0.057 |
| Fdamdd | 0.968 |
| Skinsen | 0.039 |
| Ec | 0.003 |
| Ei | 0.027 |
| Respiratory | 0.016 |
| Bcf | 2.17 |
| Igc50 | 4.953 |
| Lc50 | 6.205 |
| Lc50dm | 6.491 |
| Nr-ar | 0.529 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.016 |
| Nr-aromatase | 0.559 |
| Nr-er | 0.326 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.073 |
| Sr-are | 0.123 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.011 |
| Sr-mmp | 0.422 |
| Sr-p53 | 0.096 |
| Vol | 442.284 |
| Dense | 0.991 |
| Flex | 0.381 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.535 |
| Synth | 3.004 |
| Fsp3 | 0.208 |
| Mce-18 | 38 |
| Natural product-likeness | -1.208 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |