| General Information | |
|---|---|
| ZINC ID | ZINC000036479714 |
| Molecular Weight (Da) | 406 |
| SMILES | C=CCn1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN(C1CCCC1)CC2 |
| Molecular Formula | C26N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.152 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 4.994 |
| Activity (Ki) in nM | 8.9125 |
| Polar Surface Area (PSA) | 28.48 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.699 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.58 |
| Ilogp | 4.39 |
| Xlogp3 | 4.66 |
| Wlogp | 4.09 |
| Mlogp | 3.88 |
| Silicos-it log p | 4.54 |
| Consensus log p | 4.31 |
| Esol log s | -5.18 |
| Esol solubility (mg/ml) | 0.00267 |
| Esol solubility (mol/l) | 0.00000657 |
| Esol class | Moderately |
| Ali log s | -4.98 |
| Ali solubility (mg/ml) | 0.0042 |
| Ali solubility (mol/l) | 0.0000104 |
| Ali class | Moderately |
| Silicos-it logsw | -5.38 |
| Silicos-it solubility (mg/ml) | 0.00169 |
| Silicos-it solubility (mol/l) | 0.00000418 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.47 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.18 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.136 |
| Logd | 3.964 |
| Logp | 4.624 |
| F (20%) | 0.024 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 85.73% |
| Vdss | 2.323 |
| Fu | 7.51% |
| Cyp1a2-inh | 0.163 |
| Cyp1a2-sub | 0.921 |
| Cyp2c19-inh | 0.583 |
| Cyp2c19-sub | 0.479 |
| Cl | 4.654 |
| T12 | 0.075 |
| H-ht | 0.967 |
| Dili | 0.784 |
| Roa | 0.799 |
| Fdamdd | 0.701 |
| Skinsen | 0.38 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.83 |
| Bcf | 1.936 |
| Igc50 | 4.516 |
| Lc50 | 5.357 |
| Lc50dm | 4.846 |
| Nr-ar | 0.426 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.655 |
| Nr-aromatase | 0.035 |
| Nr-er | 0.214 |
| Nr-er-lbd | 0.495 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.413 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.251 |
| Sr-mmp | 0.052 |
| Sr-p53 | 0.14 |
| Vol | 441.432 |
| Dense | 0.918 |
| Flex | 0.179 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.67 |
| Synth | 2.611 |
| Fsp3 | 0.577 |
| Mce-18 | 68.488 |
| Natural product-likeness | -0.982 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |