| General Information | |
|---|---|
| ZINC ID | ZINC000036294920 |
| Molecular Weight (Da) | 406 |
| SMILES | CCCCCCCC/C=CC/C=CC/C=CC/C=CCC[C@@H](C)C(=O)NCCF |
| Molecular Formula | C26F1N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.651 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| LogP | 8.249 |
| Activity (Ki) in nM | 8.1283 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.027 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.65 |
| Ilogp | 4.32 |
| Xlogp3 | 6.11 |
| Wlogp | 8.05 |
| Mlogp | 4.86 |
| Silicos-it log p | 5.44 |
| Consensus log p | 5.44 |
| Esol log s | -6.47 |
| Esol solubility (mg/ml) | 0.000145 |
| Esol solubility (mol/l) | 0.00000033 |
| Esol class | Poorly sol |
| Ali log s | -6.88 |
| Ali solubility (mg/ml) | 0.0000574 |
| Ali solubility (mol/l) | 0.00000013 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.29 |
| Silicos-it solubility (mg/ml) | 0.00000224 |
| Silicos-it solubility (mol/l) | 5.19E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.6 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.07 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.547 |
| Logd | 4.119 |
| Logp | 3.9 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 100.27% |
| Vdss | 3.15 |
| Fu | 1.11% |
| Cyp1a2-inh | 0.16 |
| Cyp1a2-sub | 0.9 |
| Cyp2c19-inh | 0.363 |
| Cyp2c19-sub | 0.166 |
| Cl | 4.047 |
| T12 | 0.917 |
| H-ht | 0.387 |
| Dili | 0.026 |
| Roa | 0.022 |
| Fdamdd | 0.405 |
| Skinsen | 0.948 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.961 |
| Bcf | 1.178 |
| Igc50 | 5.348 |
| Lc50 | 2.693 |
| Lc50dm | 4.86 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.002 |
| Nr-aromatase | 0.141 |
| Nr-er | 0.12 |
| Nr-er-lbd | 0.018 |
| Nr-ppar-gamma | 0.475 |
| Sr-are | 0.725 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.959 |
| Sr-mmp | 0.499 |
| Sr-p53 | 0.116 |
| Vol | 470.924 |
| Dense | 0.861 |
| Flex | 4 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.174 |
| Synth | 3.475 |
| Fsp3 | 0.654 |
| Mce-18 | 2 |
| Natural product-likeness | 0.637 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |