| General Information | |
|---|---|
| ZINC ID | ZINC000036294855 |
| Molecular Weight (Da) | 490 |
| SMILES | C[C@H](NC(=O)C(C)(C)Oc1ccc(Cl)cc1)[C@@H](Cc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| Molecular Formula | C27Cl1F3N1O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.262 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| LogP | 7.366 |
| Activity (Ki) in nM | 3.3884 |
| Polar Surface Area (PSA) | 38.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.965 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.43 |
| Xlogp3 | 7.48 |
| Wlogp | 8.2 |
| Mlogp | 5.85 |
| Silicos-it log p | 7.42 |
| Consensus log p | 6.68 |
| Esol log s | -7.32 |
| Esol solubility (mg/ml) | 0.0000233 |
| Esol solubility (mol/l) | 4.77E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.12 |
| Ali solubility (mg/ml) | 0.00000373 |
| Ali solubility (mol/l) | 7.62E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.22 |
| Silicos-it solubility (mg/ml) | 2.96E-08 |
| Silicos-it solubility (mol/l) | 6.04E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.98 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.71 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.637 |
| Logd | 4.513 |
| Logp | 6.698 |
| F (20%) | 0.036 |
| F (30%) | 0.019 |
| Mdck | - |
| Ppb | 100.11% |
| Vdss | 1.48 |
| Fu | 0.68% |
| Cyp1a2-inh | 0.258 |
| Cyp1a2-sub | 0.873 |
| Cyp2c19-inh | 0.85 |
| Cyp2c19-sub | 0.148 |
| Cl | 5.144 |
| T12 | 0.008 |
| H-ht | 0.957 |
| Dili | 0.935 |
| Roa | 0.096 |
| Fdamdd | 0.487 |
| Skinsen | 0.016 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.641 |
| Bcf | 2.217 |
| Igc50 | 4.548 |
| Lc50 | 5.841 |
| Lc50dm | 6.575 |
| Nr-ar | 0.028 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.005 |
| Nr-aromatase | 0.013 |
| Nr-er | 0.539 |
| Nr-er-lbd | 0.119 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.401 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.013 |
| Sr-mmp | 0.695 |
| Sr-p53 | 0.061 |
| Vol | 485.505 |
| Dense | 1.008 |
| Flex | 0.526 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.368 |
| Synth | 3.047 |
| Fsp3 | 0.296 |
| Mce-18 | 46 |
| Natural product-likeness | -0.79 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |