| General Information | |
|---|---|
| ZINC ID | ZINC000036294796 |
| Molecular Weight (Da) | 402 |
| SMILES | CCCCCCCC/C=CCCCCCCCC(=O)NCc1ccc(OC)cc1 |
| Molecular Formula | C26N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.197 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| LogP | 8.006 |
| Activity (Ki) in nM | 501.187 |
| Polar Surface Area (PSA) | 38.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94557267 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 5.32 |
| Xlogp3 | 8.48 |
| Wlogp | 7.2 |
| Mlogp | 5.02 |
| Silicos-it log p | 8.11 |
| Consensus log p | 6.82 |
| Esol log s | -6.57 |
| Esol solubility (mg/ml) | 0.000108 |
| Esol solubility (mol/l) | 0.00000026 |
| Esol class | Poorly sol |
| Ali log s | -9.16 |
| Ali solubility (mg/ml) | 0.00000028 |
| Ali solubility (mol/l) | 6.99E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.99 |
| Silicos-it solubility (mg/ml) | 0.0000004 |
| Silicos-it solubility (mol/l) | 1.01E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.73 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.1 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.143 |
| Logd | 4.695 |
| Logp | 7.174 |
| F (20%) | 0.992 |
| F (30%) | 0.998 |
| Mdck | - |
| Ppb | 99.48% |
| Vdss | 2.066 |
| Fu | 0.67% |
| Cyp1a2-inh | 0.129 |
| Cyp1a2-sub | 0.785 |
| Cyp2c19-inh | 0.481 |
| Cyp2c19-sub | 0.315 |
| Cl | 5.249 |
| T12 | 0.679 |
| H-ht | 0.156 |
| Dili | 0.054 |
| Roa | 0.048 |
| Fdamdd | 0.044 |
| Skinsen | 0.962 |
| Ec | 0.004 |
| Ei | 0.053 |
| Respiratory | 0.796 |
| Bcf | 1.213 |
| Igc50 | 5.568 |
| Lc50 | 3.67 |
| Lc50dm | 5.887 |
| Nr-ar | 0.047 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.009 |
| Nr-aromatase | 0.039 |
| Nr-er | 0.341 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.238 |
| Sr-are | 0.409 |
| Sr-atad5 | 0.064 |
| Sr-hse | 0.737 |
| Sr-mmp | 0.517 |
| Sr-p53 | 0.016 |
| Vol | 465.091 |
| Dense | 0.863 |
| Flex | 2.375 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.206 |
| Synth | 2.082 |
| Fsp3 | 0.654 |
| Mce-18 | 6 |
| Natural product-likeness | -0.015 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |