| General Information | |
|---|---|
| ZINC ID | ZINC000036294751 |
| Molecular Weight (Da) | 384 |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(C(C)(C)CCC[C@H](O)C#N)cc1OC2(C)C |
| Molecular Formula | C24N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.984 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 5.183 |
| Activity (Ki) in nM | 12.8825 |
| Polar Surface Area (PSA) | 73.48 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.877 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.62 |
| Ilogp | 3.83 |
| Xlogp3 | 7.11 |
| Wlogp | 5.34 |
| Mlogp | 3.22 |
| Silicos-it log p | 5.03 |
| Consensus log p | 4.91 |
| Esol log s | -6.53 |
| Esol solubility (mg/ml) | 0.000114 |
| Esol solubility (mol/l) | 0.00000029 |
| Esol class | Poorly sol |
| Ali log s | -8.47 |
| Ali solubility (mg/ml) | 0.00000129 |
| Ali solubility (mol/l) | 3.37E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.47 |
| Silicos-it solubility (mg/ml) | 0.00128 |
| Silicos-it solubility (mol/l) | 0.00000335 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.59 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.566 |
| Logd | 4.587 |
| Logp | 6.825 |
| F (20%) | 0.991 |
| F (30%) | 0.392 |
| Mdck | - |
| Ppb | 99.45% |
| Vdss | 2.655 |
| Fu | 4.83% |
| Cyp1a2-inh | 0.13 |
| Cyp1a2-sub | 0.774 |
| Cyp2c19-inh | 0.412 |
| Cyp2c19-sub | 0.487 |
| Cl | 7.066 |
| T12 | 0.135 |
| H-ht | 0.973 |
| Dili | 0.719 |
| Roa | 0.993 |
| Fdamdd | 0.999 |
| Skinsen | 0.649 |
| Ec | 0.011 |
| Ei | 0.234 |
| Respiratory | 0.981 |
| Bcf | 2.015 |
| Igc50 | 5.001 |
| Lc50 | 6.587 |
| Lc50dm | 7.834 |
| Nr-ar | 0.244 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.12 |
| Nr-aromatase | 0.834 |
| Nr-er | 0.162 |
| Nr-er-lbd | 0.34 |
| Nr-ppar-gamma | 0.728 |
| Sr-are | 0.667 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.37 |
| Sr-mmp | 0.965 |
| Sr-p53 | 0.732 |
| Vol | 419.539 |
| Dense | 0.914 |
| Flex | 0.294 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.532 |
| Synth | 4.191 |
| Fsp3 | 0.625 |
| Mce-18 | 74.897 |
| Natural product-likeness | 1.767 |
| Alarm nmr | 0 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |