| General Information | |
|---|---|
| ZINC ID | ZINC000036294734 |
| Molecular Weight (Da) | 555 |
| SMILES | O=C(NN1C[C@H]2CCC[C@@H]2C1)c1nc(-c2ccc(Cl)cc2Cl)n(-c2ccc(Cl)cc2)c1Br |
| Molecular Formula | C23Br1Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 131.228 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| LogP | 7.157 |
| Activity (Ki) in nM | 10.9648 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.028 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.3 |
| Ilogp | 4 |
| Xlogp3 | 7.4 |
| Wlogp | 6.26 |
| Mlogp | 5.72 |
| Silicos-it log p | 5.28 |
| Consensus log p | 5.73 |
| Esol log s | -8 |
| Esol solubility (mg/ml) | 0.00000549 |
| Esol solubility (mol/l) | 9.90E-09 |
| Esol class | Poorly sol |
| Ali log s | -8.28 |
| Ali solubility (mg/ml) | 0.00000289 |
| Ali solubility (mol/l) | 5.21E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.71 |
| Silicos-it solubility (mg/ml) | 0.00000107 |
| Silicos-it solubility (mol/l) | 1.93E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.43 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.26 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.364 |
| Logd | 4.957 |
| Logp | 6.016 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 99.66% |
| Vdss | 0.708 |
| Fu | 1.59% |
| Cyp1a2-inh | 0.429 |
| Cyp1a2-sub | 0.794 |
| Cyp2c19-inh | 0.862 |
| Cyp2c19-sub | 0.755 |
| Cl | 1.487 |
| T12 | 0.026 |
| H-ht | 0.754 |
| Dili | 0.96 |
| Roa | 0.471 |
| Fdamdd | 0.907 |
| Skinsen | 0.292 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.662 |
| Bcf | 2.517 |
| Igc50 | 4.958 |
| Lc50 | 6.282 |
| Lc50dm | 6.145 |
| Nr-ar | 0.139 |
| Nr-ar-lbd | 0.312 |
| Nr-ahr | 0.891 |
| Nr-aromatase | 0.855 |
| Nr-er | 0.764 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.642 |
| Sr-are | 0.941 |
| Sr-atad5 | 0.305 |
| Sr-hse | 0.881 |
| Sr-mmp | 0.966 |
| Sr-p53 | 0.936 |
| Vol | 457.548 |
| Dense | 1.206 |
| Flex | 0.185 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.394 |
| Synth | 3.52 |
| Fsp3 | 0.304 |
| Mce-18 | 97.067 |
| Natural product-likeness | -1.02 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |