| General Information | |
|---|---|
| ZINC ID | ZINC000036294723 |
| Molecular Weight (Da) | 477 |
| SMILES | O=C(NN1C[C@@H]2CCC[C@H]2C1)c1nc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2Cl)n1 |
| Molecular Formula | C22Cl3N5O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.174 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| LogP | 5.521 |
| Activity (Ki) in nM | 162.181 |
| Polar Surface Area (PSA) | 63.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.00102543 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.32 |
| Ilogp | 3.9 |
| Xlogp3 | 6.37 |
| Wlogp | 4.89 |
| Mlogp | 4.94 |
| Silicos-it log p | 4.04 |
| Consensus log p | 4.83 |
| Esol log s | -6.88 |
| Esol solubility (mg/ml) | 0.0000621 |
| Esol solubility (mol/l) | 0.00000013 |
| Esol class | Poorly sol |
| Ali log s | -7.49 |
| Ali solubility (mg/ml) | 0.0000156 |
| Ali solubility (mol/l) | 3.27E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.58 |
| Silicos-it solubility (mg/ml) | 0.0000125 |
| Silicos-it solubility (mol/l) | 2.62E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.69 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.14 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.949 |
| Logd | 4.695 |
| Logp | 5.693 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 99.69% |
| Vdss | 0.423 |
| Fu | 1.22% |
| Cyp1a2-inh | 0.439 |
| Cyp1a2-sub | 0.851 |
| Cyp2c19-inh | 0.938 |
| Cyp2c19-sub | 0.635 |
| Cl | 2.015 |
| T12 | 0.039 |
| H-ht | 0.984 |
| Dili | 0.984 |
| Roa | 0.605 |
| Fdamdd | 0.797 |
| Skinsen | 0.144 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.848 |
| Bcf | 2.087 |
| Igc50 | 4.882 |
| Lc50 | 5.737 |
| Lc50dm | 4.906 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.907 |
| Nr-aromatase | 0.914 |
| Nr-er | 0.637 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.113 |
| Sr-are | 0.931 |
| Sr-atad5 | 0.587 |
| Sr-hse | 0.462 |
| Sr-mmp | 0.909 |
| Sr-p53 | 0.966 |
| Vol | 431.965 |
| Dense | 1.1 |
| Flex | 0.185 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.557 |
| Synth | 3.388 |
| Fsp3 | 0.318 |
| Mce-18 | 94.034 |
| Natural product-likeness | -1.321 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |