| General Information | |
|---|---|
| ZINC ID | ZINC000036294669 |
| Molecular Weight (Da) | 500 |
| SMILES | C#Cc1c(C(=O)NN2C[C@H]3CCC[C@@H]3C2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(Cl)cc1 |
| Molecular Formula | C25Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.213 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 7.728 |
| Activity (Ki) in nM | 776.247 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.1088382 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.28 |
| Ilogp | 4.61 |
| Xlogp3 | 6.66 |
| Wlogp | 5.56 |
| Mlogp | 5.47 |
| Silicos-it log p | 5.35 |
| Consensus log p | 5.53 |
| Esol log s | -7.19 |
| Esol solubility (mg/ml) | 0.0000326 |
| Esol solubility (mol/l) | 6.52E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.52 |
| Ali solubility (mg/ml) | 0.0000152 |
| Ali solubility (mol/l) | 3.05E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.01 |
| Silicos-it solubility (mg/ml) | 0.00000487 |
| Silicos-it solubility (mol/l) | 9.75E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.62 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.326 |
| Logd | 4.802 |
| Logp | 5.86 |
| F (20%) | 0.002 |
| F (30%) | 0.008 |
| Mdck | - |
| Ppb | 98.88% |
| Vdss | 0.339 |
| Fu | 1.24% |
| Cyp1a2-inh | 0.407 |
| Cyp1a2-sub | 0.863 |
| Cyp2c19-inh | 0.862 |
| Cyp2c19-sub | 0.735 |
| Cl | 3.481 |
| T12 | 0.023 |
| H-ht | 0.956 |
| Dili | 0.976 |
| Roa | 0.281 |
| Fdamdd | 0.941 |
| Skinsen | 0.198 |
| Ec | 0.003 |
| Ei | 0.045 |
| Respiratory | 0.734 |
| Bcf | 3.158 |
| Igc50 | 5.288 |
| Lc50 | 6.878 |
| Lc50dm | 6.588 |
| Nr-ar | 0.032 |
| Nr-ar-lbd | 0.162 |
| Nr-ahr | 0.89 |
| Nr-aromatase | 0.886 |
| Nr-er | 0.708 |
| Nr-er-lbd | 0.028 |
| Nr-ppar-gamma | 0.56 |
| Sr-are | 0.955 |
| Sr-atad5 | 0.35 |
| Sr-hse | 0.884 |
| Sr-mmp | 0.962 |
| Sr-p53 | 0.967 |
| Vol | 467.583 |
| Dense | 1.065 |
| Flex | 0.179 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.458 |
| Synth | 3.649 |
| Fsp3 | 0.28 |
| Mce-18 | 96.25 |
| Natural product-likeness | -1.052 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |