| General Information | |
|---|---|
| ZINC ID | ZINC000035813765 |
| Molecular Weight (Da) | 351 |
| SMILES | CC1(C)C(C(=O)c2cn(CCCC(F)(F)F)c3ccccc23)C1(C)C |
| Molecular Formula | C20F3N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 90.428 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| LogP | 5.1 |
| Activity (Ki) in nM | 14.7911 |
| Polar Surface Area (PSA) | 22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.095 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.55 |
| Ilogp | 3.36 |
| Xlogp3 | 5.57 |
| Wlogp | 7.11 |
| Mlogp | 4.07 |
| Silicos-it log p | 5.66 |
| Consensus log p | 5.15 |
| Esol log s | -5.4 |
| Esol solubility (mg/ml) | 0.0014 |
| Esol solubility (mol/l) | 0.000004 |
| Esol class | Moderately |
| Ali log s | -5.79 |
| Ali solubility (mg/ml) | 0.000566 |
| Ali solubility (mol/l) | 0.00000161 |
| Ali class | Moderately |
| Silicos-it logsw | -6.59 |
| Silicos-it solubility (mg/ml) | 0.0000897 |
| Silicos-it solubility (mol/l) | 0.00000025 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.49 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.54 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.423 |
| Logd | 4.437 |
| Logp | 5.32 |
| F (20%) | 0.012 |
| F (30%) | 0.753 |
| Mdck | - |
| Ppb | 96.19% |
| Vdss | 2.199 |
| Fu | 2.49% |
| Cyp1a2-inh | 0.128 |
| Cyp1a2-sub | 0.903 |
| Cyp2c19-inh | 0.794 |
| Cyp2c19-sub | 0.749 |
| Cl | 4.925 |
| T12 | 0.011 |
| H-ht | 0.337 |
| Dili | 0.797 |
| Roa | 0.26 |
| Fdamdd | 0.903 |
| Skinsen | 0.121 |
| Ec | 0.004 |
| Ei | 0.738 |
| Respiratory | 0.935 |
| Bcf | 1.634 |
| Igc50 | 4.982 |
| Lc50 | 6.774 |
| Lc50dm | 6.769 |
| Nr-ar | 0.053 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.098 |
| Nr-aromatase | 0.877 |
| Nr-er | 0.25 |
| Nr-er-lbd | 0.149 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.139 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.194 |
| Sr-mmp | 0.525 |
| Sr-p53 | 0.019 |
| Vol | 353.614 |
| Dense | 0.993 |
| Flex | 0.429 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.62 |
| Synth | 2.625 |
| Fsp3 | 0.55 |
| Mce-18 | 52.645 |
| Natural product-likeness | -0.82 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |