| General Information | |
|---|---|
| ZINC ID | ZINC000034891621 |
| Molecular Weight (Da) | 462 |
| SMILES | CN(CC(=O)NCCO)Cc1nc(-c2cn(CC3CCOCC3)c3c(Cl)cccc23)no1 |
| Molecular Formula | C22Cl1N5O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.324 |
| HBA | 6 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| LogP | 1.272 |
| Activity (Ki) in nM | 50.1187 |
| Polar Surface Area (PSA) | 105.65 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.522 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 14 |
| Fraction csp3 | 0.5 |
| Ilogp | 3.65 |
| Xlogp3 | 1.57 |
| Wlogp | 2.16 |
| Mlogp | 0.62 |
| Silicos-it log p | 2.67 |
| Consensus log p | 2.13 |
| Esol log s | -3.36 |
| Esol solubility (mg/ml) | 0.203 |
| Esol solubility (mol/l) | 0.00044 |
| Esol class | Soluble |
| Ali log s | -3.4 |
| Ali solubility (mg/ml) | 0.184 |
| Ali solubility (mol/l) | 0.000399 |
| Ali class | Soluble |
| Silicos-it logsw | -5.99 |
| Silicos-it solubility (mg/ml) | 0.000468 |
| Silicos-it solubility (mol/l) | 0.00000101 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -8 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.73 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.063 |
| Logd | 2.454 |
| Logp | 1.147 |
| F (20%) | 0.006 |
| F (30%) | 0.118 |
| Mdck | - |
| Ppb | 87.21% |
| Vdss | 2.086 |
| Fu | 10.15% |
| Cyp1a2-inh | 0.39 |
| Cyp1a2-sub | 0.331 |
| Cyp2c19-inh | 0.908 |
| Cyp2c19-sub | 0.282 |
| Cl | 10.989 |
| T12 | 0.386 |
| H-ht | 0.921 |
| Dili | 0.968 |
| Roa | 0.543 |
| Fdamdd | 0.808 |
| Skinsen | 0.165 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.903 |
| Bcf | 0.612 |
| Igc50 | 2.33 |
| Lc50 | 2.886 |
| Lc50dm | 3.612 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.073 |
| Nr-aromatase | 0.011 |
| Nr-er | 0.197 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.549 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.008 |
| Sr-mmp | 0.045 |
| Sr-p53 | 0.055 |
| Vol | 441.743 |
| Dense | 1.044 |
| Flex | 0.455 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.503 |
| Synth | 2.836 |
| Fsp3 | 0.5 |
| Mce-18 | 50.667 |
| Natural product-likeness | -1.855 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |