| General Information | |
|---|---|
| ZINC ID | ZINC000029124781 |
| Molecular Weight (Da) | 379 |
| SMILES | Cn1c(C(C)(C)C)c/c(=NC(=O)c2cccc(C(F)(F)F)c2)n1CC1CC1 |
| Molecular Formula | C20F3N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 101.417 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 5.212 |
| Activity (Ki) in nM | 51.286 |
| Polar Surface Area (PSA) | 39.29 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.75861418 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.5 |
| Ilogp | 3.96 |
| Xlogp3 | 5.08 |
| Wlogp | 5.38 |
| Mlogp | 4.11 |
| Silicos-it log p | 4.85 |
| Consensus log p | 4.68 |
| Esol log s | -5.3 |
| Esol solubility (mg/ml) | 1.91E-03 |
| Esol solubility (mol/l) | 5.03E-06 |
| Esol class | Moderately |
| Ali log s | -5.65 |
| Ali solubility (mg/ml) | 8.54E-04 |
| Ali solubility (mol/l) | 2.25E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -5.53 |
| Silicos-it solubility (mg/ml) | 1.12E-03 |
| Silicos-it solubility (mol/l) | 2.96E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.01 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.52 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.176 |
| Logd | 4.059 |
| Logp | 4.584 |
| F (20%) | 0.062 |
| F (30%) | 0.361 |
| Mdck | 1.55E-05 |
| Ppb | 0.9569 |
| Vdss | 3.284 |
| Fu | 0.0317 |
| Cyp1a2-inh | 0.475 |
| Cyp1a2-sub | 0.912 |
| Cyp2c19-inh | 0.861 |
| Cyp2c19-sub | 0.724 |
| Cl | 8.544 |
| T12 | 0.1 |
| H-ht | 0.695 |
| Dili | 0.547 |
| Roa | 0.62 |
| Fdamdd | 0.821 |
| Skinsen | 0.034 |
| Ec | 0.003 |
| Ei | 0.022 |
| Respiratory | 0.873 |
| Bcf | 1.715 |
| Igc50 | 4.437 |
| Lc50 | 5.644 |
| Lc50dm | 5.973 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.014 |
| Nr-aromatase | 0.163 |
| Nr-er | 0.274 |
| Nr-er-lbd | 0.02 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.553 |
| Sr-atad5 | 0.001 |
| Sr-hse | 0.058 |
| Sr-mmp | 0.657 |
| Sr-p53 | 0.043 |
| Vol | 372.971 |
| Dense | 1.017 |
| Flex | 16 |
| Nstereo | 0.375 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0 |
| Synth | 0.784 |
| Fsp3 | 2.876 |
| Mce-18 | 0.5 |
| Natural product-likeness | 50.6 |
| Alarm nmr | -1.362 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |