| General Information | |
|---|---|
| ZINC ID | ZINC000029124532 |
| Molecular Weight (Da) | 361 |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CC[C@H]2CCCO)cc1 |
| Molecular Formula | C24O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.268 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| LogP | 6.404 |
| Activity (Ki) in nM | 549.541 |
| Polar Surface Area (PSA) | 40.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.93758195 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.75 |
| Ilogp | 4.14 |
| Xlogp3 | 6.49 |
| Wlogp | 5.95 |
| Mlogp | 4.59 |
| Silicos-it log p | 6.22 |
| Consensus log p | 5.48 |
| Esol log s | -5.68 |
| Esol solubility (mg/ml) | 0.000762 |
| Esol solubility (mol/l) | 0.00000211 |
| Esol class | Moderately |
| Ali log s | -7.14 |
| Ali solubility (mg/ml) | 0.0000264 |
| Ali solubility (mol/l) | 7.32E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.62 |
| Silicos-it solubility (mg/ml) | 0.0000857 |
| Silicos-it solubility (mol/l) | 0.00000023 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.89 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.63 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.834 |
| Logd | 4.882 |
| Logp | 6.988 |
| F (20%) | 0.15 |
| F (30%) | 0.562 |
| Mdck | - |
| Ppb | 97.72% |
| Vdss | 1.298 |
| Fu | 1.88% |
| Cyp1a2-inh | 0.161 |
| Cyp1a2-sub | 0.84 |
| Cyp2c19-inh | 0.497 |
| Cyp2c19-sub | 0.532 |
| Cl | 6.356 |
| T12 | 0.05 |
| H-ht | 0.144 |
| Dili | 0.033 |
| Roa | 0.048 |
| Fdamdd | 0.638 |
| Skinsen | 0.952 |
| Ec | 0.766 |
| Ei | 0.968 |
| Respiratory | 0.057 |
| Bcf | 2.621 |
| Igc50 | 5.334 |
| Lc50 | 6.205 |
| Lc50dm | 5.32 |
| Nr-ar | 0.166 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.003 |
| Nr-aromatase | 0.424 |
| Nr-er | 0.272 |
| Nr-er-lbd | 0.052 |
| Nr-ppar-gamma | 0.05 |
| Sr-are | 0.403 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.202 |
| Sr-mmp | 0.646 |
| Sr-p53 | 0.154 |
| Vol | 416.218 |
| Dense | 0.866 |
| Flex | 0.833 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.506 |
| Synth | 3.398 |
| Fsp3 | 0.75 |
| Mce-18 | 46 |
| Natural product-likeness | 1.187 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |