| General Information | |
|---|---|
| ZINC ID | ZINC000029048153 |
| Molecular Weight (Da) | 498 |
| SMILES | CC(=O)N(C)Cc1ccc(S(=O)(=O)c2ccc3c(c2)nc(C(C)(C)C)n3CC2CCOCC2)cc1 |
| Molecular Formula | C27N3O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 136.463 |
| HBA | 5 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| LogP | 4.168 |
| Activity (Ki) in nM | 1.585 |
| Polar Surface Area (PSA) | 89.88 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.71959185 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.48 |
| Ilogp | 3.96 |
| Xlogp3 | 3.77 |
| Wlogp | 5.5 |
| Mlogp | 3.09 |
| Silicos-it log p | 4.06 |
| Consensus log p | 4.08 |
| Esol log s | -5.09 |
| Esol solubility (mg/ml) | 4.05E-03 |
| Esol solubility (mol/l) | 8.13E-06 |
| Esol class | Moderately |
| Ali log s | -5.35 |
| Ali solubility (mg/ml) | 2.22E-03 |
| Ali solubility (mol/l) | 4.46E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -7.33 |
| Silicos-it solubility (mg/ml) | 2.33E-05 |
| Silicos-it solubility (mol/l) | 4.69E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.66 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.61 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.537 |
| Logd | 2.98 |
| Logp | 3.379 |
| F (20%) | 0.022 |
| F (30%) | 0.496 |
| Mdck | 2.29E-05 |
| Ppb | 0.9387 |
| Vdss | 0.443 |
| Fu | 0.0411 |
| Cyp1a2-inh | 0.051 |
| Cyp1a2-sub | 0.263 |
| Cyp2c19-inh | 0.814 |
| Cyp2c19-sub | 0.838 |
| Cl | 1.926 |
| T12 | 0.058 |
| H-ht | 0.918 |
| Dili | 0.976 |
| Roa | 0.068 |
| Fdamdd | 0.953 |
| Skinsen | 0.024 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.029 |
| Bcf | 0.525 |
| Igc50 | 2.894 |
| Lc50 | 3.385 |
| Lc50dm | 4.086 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.02 |
| Nr-ahr | 0.088 |
| Nr-aromatase | 0.783 |
| Nr-er | 0.421 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.011 |
| Sr-are | 0.842 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.016 |
| Sr-mmp | 0.77 |
| Sr-p53 | 0.007 |
| Vol | 506.891 |
| Dense | 0.981 |
| Flex | 25 |
| Nstereo | 0.32 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.498 |
| Fsp3 | 2.681 |
| Mce-18 | 0.481 |
| Natural product-likeness | 63 |
| Alarm nmr | -1.541 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Accepted |
| Goldentriangle | Rejected |