| General Information | |
|---|---|
| ZINC ID | ZINC000029046974 |
| Molecular Weight (Da) | 461 |
| SMILES | CCOc1ccc(Cc2nc3cc([S@](=O)CC)c(Cl)cc3n2CC2CCOCC2)cc1 |
| Molecular Formula | C24Cl1N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.495 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| LogP | 4.661 |
| Activity (Ki) in nM | 19.953 |
| Polar Surface Area (PSA) | 72.56 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.80171632 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.46 |
| Ilogp | 3.88 |
| Xlogp3 | 4.32 |
| Wlogp | 6.1 |
| Mlogp | 3.5 |
| Silicos-it log p | 4.98 |
| Consensus log p | 4.56 |
| Esol log s | -5.25 |
| Esol solubility (mg/ml) | 2.59E-03 |
| Esol solubility (mol/l) | 5.62E-06 |
| Esol class | Moderately |
| Ali log s | -5.56 |
| Ali solubility (mg/ml) | 1.28E-03 |
| Ali solubility (mol/l) | 2.77E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -8.13 |
| Silicos-it solubility (mg/ml) | 3.40E-06 |
| Silicos-it solubility (mol/l) | 7.38E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.05 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.85 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.03 |
| Logd | 3.505 |
| Logp | 5.32 |
| F (20%) | 0.005 |
| F (30%) | 0.005 |
| Mdck | 4.67E-05 |
| Ppb | 0.9807 |
| Vdss | 0.922 |
| Fu | 0.0206 |
| Cyp1a2-inh | 0.146 |
| Cyp1a2-sub | 0.523 |
| Cyp2c19-inh | 0.816 |
| Cyp2c19-sub | 0.29 |
| Cl | 9.702 |
| T12 | 0.187 |
| H-ht | 0.508 |
| Dili | 0.469 |
| Roa | 0.614 |
| Fdamdd | 0.955 |
| Skinsen | 0.045 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.893 |
| Bcf | 2.605 |
| Igc50 | 5.155 |
| Lc50 | 6.64 |
| Lc50dm | 6.859 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.305 |
| Nr-aromatase | 0.953 |
| Nr-er | 0.452 |
| Nr-er-lbd | 0.127 |
| Nr-ppar-gamma | 0.172 |
| Sr-are | 0.896 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.373 |
| Sr-mmp | 0.552 |
| Sr-p53 | 0.722 |
| Vol | 453.063 |
| Dense | 1.016 |
| Flex | 22 |
| Nstereo | 0.364 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 4 |
| Synth | 0.431 |
| Fsp3 | 3.548 |
| Mce-18 | 0.458 |
| Natural product-likeness | 72.286 |
| Alarm nmr | -1.058 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |