| General Information | |
|---|---|
| ZINC ID | ZINC000029045379 |
| Molecular Weight (Da) | 368 |
| SMILES | Cc1ccc(C(=O)N[C@@H](C)C(C)(C)C)cc1S(=O)(=O)N1CCOCC1 |
| Molecular Formula | C18N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 98.163 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| LogP | 2.172 |
| Activity (Ki) in nM | 125.893 |
| Polar Surface Area (PSA) | 84.09 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.62484228 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.61 |
| Ilogp | 3.27 |
| Xlogp3 | 2.5 |
| Wlogp | 2.88 |
| Mlogp | 1.39 |
| Silicos-it log p | 2.23 |
| Consensus log p | 2.45 |
| Esol log s | -3.48 |
| Esol solubility (mg/ml) | 0.122 |
| Esol solubility (mol/l) | 0.00033 |
| Esol class | Soluble |
| Ali log s | -3.91 |
| Ali solubility (mg/ml) | 0.0452 |
| Ali solubility (mol/l) | 0.000123 |
| Ali class | Soluble |
| Silicos-it logsw | -4.49 |
| Silicos-it solubility (mg/ml) | 0.012 |
| Silicos-it solubility (mol/l) | 0.0000324 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.77 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.49 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.187 |
| Logd | 2.729 |
| Logp | 3.086 |
| F (20%) | 0.024 |
| F (30%) | 0.004 |
| Mdck | 3.37E-05 |
| Ppb | 0.9428 |
| Vdss | 0.693 |
| Fu | 0.1397 |
| Cyp1a2-inh | 0.057 |
| Cyp1a2-sub | 0.104 |
| Cyp2c19-inh | 0.281 |
| Cyp2c19-sub | 0.831 |
| Cl | 7.491 |
| T12 | 0.215 |
| H-ht | 0.477 |
| Dili | 0.979 |
| Roa | 0.028 |
| Fdamdd | 0.265 |
| Skinsen | 0.053 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.024 |
| Bcf | 0.437 |
| Igc50 | 2.799 |
| Lc50 | 3.68 |
| Lc50dm | 4.025 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.043 |
| Nr-aromatase | 0.926 |
| Nr-er | 0.236 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.036 |
| Sr-are | 0.565 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.01 |
| Sr-mmp | 0.448 |
| Sr-p53 | 0.009 |
| Vol | 367.889 |
| Dense | 1.001 |
| Flex | 0.4 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.884 |
| Synth | 2.658 |
| Fsp3 | 0.611 |
| Mce-18 | 58.966 |
| Natural product-likeness | -1.787 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |