| General Information | |
|---|---|
| ZINC ID | ZINC000029037955 |
| Molecular Weight (Da) | 410 |
| SMILES | Cc1ccc(C(=O)Nc2nccc3ccccc23)cc1S(=O)(=O)N1CCCCC1 |
| Molecular Formula | C22N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.053 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 3.435 |
| Activity (Ki) in nM | 1 |
| Polar Surface Area (PSA) | 87.75 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.08608186 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.27 |
| Ilogp | 3.2 |
| Xlogp3 | 3.63 |
| Wlogp | 4.48 |
| Mlogp | 2.82 |
| Silicos-it log p | 2.97 |
| Consensus log p | 3.42 |
| Esol log s | -4.74 |
| Esol solubility (mg/ml) | 7.38E-03 |
| Esol solubility (mol/l) | 1.80E-05 |
| Esol class | Moderately |
| Ali log s | -5.16 |
| Ali solubility (mg/ml) | 2.83E-03 |
| Ali solubility (mol/l) | 6.91E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -7.17 |
| Silicos-it solubility (mg/ml) | 2.78E-05 |
| Silicos-it solubility (mol/l) | 6.79E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.22 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.95 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.831 |
| Logd | 3.684 |
| Logp | 3.94 |
| F (20%) | 0.019 |
| F (30%) | 0.006 |
| Mdck | 2.21E-05 |
| Ppb | 0.9781 |
| Vdss | 0.622 |
| Fu | 0.0137 |
| Cyp1a2-inh | 0.624 |
| Cyp1a2-sub | 0.72 |
| Cyp2c19-inh | 0.911 |
| Cyp2c19-sub | 0.154 |
| Cl | 2.994 |
| T12 | 0.187 |
| H-ht | 0.978 |
| Dili | 0.988 |
| Roa | 0.883 |
| Fdamdd | 0.93 |
| Skinsen | 0.029 |
| Ec | 0.003 |
| Ei | 0.029 |
| Respiratory | 0.767 |
| Bcf | 0.806 |
| Igc50 | 4.432 |
| Lc50 | 5.402 |
| Lc50dm | 5.099 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.824 |
| Nr-aromatase | 0.978 |
| Nr-er | 0.264 |
| Nr-er-lbd | 0.023 |
| Nr-ppar-gamma | 0.109 |
| Sr-are | 0.745 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.638 |
| Sr-mmp | 0.889 |
| Sr-p53 | 0.463 |
| Vol | 408.984 |
| Dense | 1 |
| Flex | 27 |
| Nstereo | 0.148 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.72 |
| Fsp3 | 2.587 |
| Mce-18 | 0.273 |
| Natural product-likeness | 54.214 |
| Alarm nmr | -1.606 |
| Bms | 3 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |