| General Information | |
|---|---|
| ZINC ID | ZINC000028955383 |
| Molecular Weight (Da) | 486 |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN(CCC1CCCCC1)C2 |
| Molecular Formula | C27N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 135.524 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| LogP | 5.228 |
| Activity (Ki) in nM | 1995.262 |
| Polar Surface Area (PSA) | 71 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.389 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.67 |
| Ilogp | 4.55 |
| Xlogp3 | 5.32 |
| Wlogp | 5.01 |
| Mlogp | 4.25 |
| Silicos-it log p | 3.78 |
| Consensus log p | 4.58 |
| Esol log s | -5.94 |
| Esol solubility (mg/ml) | 0.000562 |
| Esol solubility (mol/l) | 0.00000116 |
| Esol class | Moderately |
| Ali log s | -6.56 |
| Ali solubility (mg/ml) | 0.000133 |
| Ali solubility (mol/l) | 0.00000027 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.98 |
| Silicos-it solubility (mg/ml) | 0.000513 |
| Silicos-it solubility (mol/l) | 0.00000106 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.49 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.06 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.732 |
| Logd | 4.276 |
| Logp | 5.244 |
| F (20%) | 0.196 |
| F (30%) | 0.028 |
| Mdck | 1.91E-05 |
| Ppb | 0.7412 |
| Vdss | 1.943 |
| Fu | 0.2221 |
| Cyp1a2-inh | 0.073 |
| Cyp1a2-sub | 0.795 |
| Cyp2c19-inh | 0.724 |
| Cyp2c19-sub | 0.61 |
| Cl | 5.376 |
| T12 | 0.049 |
| H-ht | 0.975 |
| Dili | 0.92 |
| Roa | 0.107 |
| Fdamdd | 0.944 |
| Skinsen | 0.138 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.575 |
| Bcf | 1.398 |
| Igc50 | 4.832 |
| Lc50 | 5.572 |
| Lc50dm | 4.253 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.119 |
| Nr-aromatase | 0.933 |
| Nr-er | 0.199 |
| Nr-er-lbd | 0.814 |
| Nr-ppar-gamma | 0.201 |
| Sr-are | 0.576 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.835 |
| Sr-mmp | 0.163 |
| Sr-p53 | 0.711 |
| Vol | 497.453 |
| Dense | 0.976 |
| Flex | 0.241 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.578 |
| Synth | 2.815 |
| Fsp3 | 0.667 |
| Mce-18 | 74.756 |
| Natural product-likeness | -1.132 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |