| General Information | |
|---|---|
| ZINC ID | ZINC000028948325 |
| Molecular Weight (Da) | 353 |
| SMILES | CC(C)c1ccccc1/N=C1SCC(C)(C)CN1Cc1ccccc1 |
| Molecular Formula | C22N2S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 109.517 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 6.129 |
| Activity (Ki) in nM | 1348.963 |
| Polar Surface Area (PSA) | 40.9 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.18741738 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.41 |
| Ilogp | 3.52 |
| Xlogp3 | 6.09 |
| Wlogp | 5.54 |
| Mlogp | 4.91 |
| Silicos-it log p | 5.92 |
| Consensus log p | 5.2 |
| Esol log s | -5.95 |
| Esol solubility (mg/ml) | 3.92E-04 |
| Esol solubility (mol/l) | 1.11E-06 |
| Esol class | Moderately |
| Ali log s | -6.73 |
| Ali solubility (mg/ml) | 6.57E-05 |
| Ali solubility (mol/l) | 1.86E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.45 |
| Silicos-it solubility (mg/ml) | 1.24E-05 |
| Silicos-it solubility (mol/l) | 3.52E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.13 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.78 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.76 |
| Logd | 4.862 |
| Logp | 5.578 |
| F (20%) | 0.002 |
| F (30%) | 0.001 |
| Mdck | 2.53E-05 |
| Ppb | 1.0004 |
| Vdss | 1.38 |
| Fu | 0.0094 |
| Cyp1a2-inh | 0.308 |
| Cyp1a2-sub | 0.914 |
| Cyp2c19-inh | 0.871 |
| Cyp2c19-sub | 0.889 |
| Cl | 5.039 |
| T12 | 0.053 |
| H-ht | 0.247 |
| Dili | 0.786 |
| Roa | 0.092 |
| Fdamdd | 0.174 |
| Skinsen | 0.355 |
| Ec | 0.004 |
| Ei | 0.07 |
| Respiratory | 0.907 |
| Bcf | 2.574 |
| Igc50 | 4.615 |
| Lc50 | 5.529 |
| Lc50dm | 6.245 |
| Nr-ar | 0.615 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.189 |
| Nr-aromatase | 0.952 |
| Nr-er | 0.685 |
| Nr-er-lbd | 0.128 |
| Nr-ppar-gamma | 0.094 |
| Sr-are | 0.365 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.759 |
| Sr-mmp | 0.781 |
| Sr-p53 | 0.01 |
| Vol | 385.446 |
| Dense | 0.914 |
| Flex | 19 |
| Nstereo | 0.211 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.663 |
| Fsp3 | 2.585 |
| Mce-18 | 0.409 |
| Natural product-likeness | 39.484 |
| Alarm nmr | -0.639 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |