| General Information | |
|---|---|
| ZINC ID | ZINC000028898715 |
| Molecular Weight (Da) | 570 |
| SMILES | C[C@H](NS(=O)(=O)C(F)(F)F)c1ccc(S(=O)(=O)c2ccc(Cl)cc2S(=O)(=O)c2ncccn2)cc1 |
| Molecular Formula | C19Cl1F3N3O6S3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.956 |
| HBA | 8 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| LogP | 4.874 |
| Activity (Ki) in nM | 20.893 |
| Polar Surface Area (PSA) | 165.37 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.922 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.16 |
| Ilogp | 1.83 |
| Xlogp3 | 3.27 |
| Wlogp | 7.47 |
| Mlogp | 1.59 |
| Silicos-it log p | 2.04 |
| Consensus log p | 3.24 |
| Esol log s | -5.29 |
| Esol solubility (mg/ml) | 0.00295 |
| Esol solubility (mol/l) | 0.00000517 |
| Esol class | Moderately |
| Ali log s | -6.42 |
| Ali solubility (mg/ml) | 0.000218 |
| Ali solubility (mol/l) | 0.00000038 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.19 |
| Silicos-it solubility (mg/ml) | 0.00000369 |
| Silicos-it solubility (mol/l) | 6.47E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.46 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 1 |
| Egan number of violations | 2 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.75 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.47 |
| Logd | 2.079 |
| Logp | 3.898 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 97.23% |
| Vdss | 0.488 |
| Fu | 1.52% |
| Cyp1a2-inh | 0.105 |
| Cyp1a2-sub | 0.347 |
| Cyp2c19-inh | 0.322 |
| Cyp2c19-sub | 0.738 |
| Cl | 1.359 |
| T12 | 0.026 |
| H-ht | 0.967 |
| Dili | 0.999 |
| Roa | 0.017 |
| Fdamdd | 0.976 |
| Skinsen | 0.074 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.625 |
| Bcf | -0.117 |
| Igc50 | 3.203 |
| Lc50 | 3.389 |
| Lc50dm | 4.799 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.043 |
| Nr-aromatase | 0.125 |
| Nr-er | 0.27 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.477 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.002 |
| Sr-mmp | 0.637 |
| Sr-p53 | 0.003 |
| Vol | 462.455 |
| Dense | 1.23 |
| Flex | 0.333 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.427 |
| Synth | 3.312 |
| Fsp3 | 0.158 |
| Mce-18 | 56 |
| Natural product-likeness | -1.274 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |