| General Information | |
|---|---|
| ZINC ID | ZINC000028822117 |
| Molecular Weight (Da) | 325 |
| SMILES | CCCCCCC(C)(C)c1ccc(-c2ccc(C)c(C)c2)c(O)c1 |
| Molecular Formula | C23O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 104.642 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| LogP | 7.735 |
| Activity (Ki) in nM | 602.56 |
| Polar Surface Area (PSA) | 20.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.0146048 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.48 |
| Ilogp | 4.6 |
| Xlogp3 | 8.3 |
| Wlogp | 6.92 |
| Mlogp | 5.71 |
| Silicos-it log p | 7.28 |
| Consensus log p | 6.56 |
| Esol log s | -6.99 |
| Esol solubility (mg/ml) | 0.0000333 |
| Esol solubility (mol/l) | 0.0000001 |
| Esol class | Poorly sol |
| Ali log s | -8.59 |
| Ali solubility (mg/ml) | 0.00000083 |
| Ali solubility (mol/l) | 2.58E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.32 |
| Silicos-it solubility (mg/ml) | 0.00000154 |
| Silicos-it solubility (mol/l) | 4.74E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.39 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.93 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.359 |
| Logd | 5.467 |
| Logp | 8.137 |
| F (20%) | 0.981 |
| F (30%) | 0.999 |
| Mdck | - |
| Ppb | 100.10% |
| Vdss | 2.438 |
| Fu | 1.27% |
| Cyp1a2-inh | 0.489 |
| Cyp1a2-sub | 0.775 |
| Cyp2c19-inh | 0.698 |
| Cyp2c19-sub | 0.107 |
| Cl | 4.944 |
| T12 | 0.043 |
| H-ht | 0.031 |
| Dili | 0.142 |
| Roa | 0.159 |
| Fdamdd | 0.636 |
| Skinsen | 0.747 |
| Ec | 0.216 |
| Ei | 0.975 |
| Respiratory | 0.102 |
| Bcf | 2.477 |
| Igc50 | 5.52 |
| Lc50 | 6.195 |
| Lc50dm | 6.408 |
| Nr-ar | 0.042 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.049 |
| Nr-aromatase | 0.758 |
| Nr-er | 0.652 |
| Nr-er-lbd | 0.87 |
| Nr-ppar-gamma | 0.44 |
| Sr-are | 0.757 |
| Sr-atad5 | 0.045 |
| Sr-hse | 0.282 |
| Sr-mmp | 0.972 |
| Sr-p53 | 0.212 |
| Vol | 382.223 |
| Dense | 0.848 |
| Flex | 0.583 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.548 |
| Synth | 2.168 |
| Fsp3 | 0.478 |
| Mce-18 | 15 |
| Natural product-likeness | 0.068 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |