| General Information | |
|---|---|
| ZINC ID | ZINC000028704881 |
| Molecular Weight (Da) | 516 |
| SMILES | C[C@H](NC(=O)C(C)(C)Oc1cncc(C(F)(F)F)c1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C27H25Cl1F3N3O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 131.843 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| LogP | 6.094 |
| Activity (Ki) in nM | 0.302 |
| Polar Surface Area (PSA) | 75.01 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.99 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.04 |
| Xlogp3 | 6.13 |
| Wlogp | 7.47 |
| Mlogp | 3.71 |
| Silicos-it log p | 6.92 |
| Consensus log p | 5.65 |
| Esol log s | -6.61 |
| Esol solubility (mg/ml) | 0.000126 |
| Esol solubility (mol/l) | 0.00000024 |
| Esol class | Poorly sol |
| Ali log s | -7.49 |
| Ali solubility (mg/ml) | 0.0000168 |
| Ali solubility (mol/l) | 3.25E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.9 |
| Silicos-it solubility (mg/ml) | 6.45E-08 |
| Silicos-it solubility (mol/l) | 1.25E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.1 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.13 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.269 |
| Logd | 4.046 |
| Logp | 5.814 |
| F (20%) | 0.002 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 99.64% |
| Vdss | 1.935 |
| Fu | 0.63% |
| Cyp1a2-inh | 0.679 |
| Cyp1a2-sub | 0.898 |
| Cyp2c19-inh | 0.883 |
| Cyp2c19-sub | 0.214 |
| Cl | 7.57 |
| T12 | 0.029 |
| H-ht | 0.965 |
| Dili | 0.959 |
| Roa | 0.107 |
| Fdamdd | 0.898 |
| Skinsen | 0.032 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.731 |
| Bcf | 1.922 |
| Igc50 | 4.019 |
| Lc50 | 5.453 |
| Lc50dm | 5.995 |
| Nr-ar | 0.041 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.01 |
| Nr-aromatase | 0.83 |
| Nr-er | 0.505 |
| Nr-er-lbd | 0.022 |
| Nr-ppar-gamma | 0.082 |
| Sr-are | 0.404 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.016 |
| Sr-mmp | 0.449 |
| Sr-p53 | 0.147 |
| Vol | 502.226 |
| Dense | 1.026 |
| Flex | 0.5 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 4 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.381 |
| Synth | 3.477 |
| Fsp3 | 0.296 |
| Mce-18 | 48 |
| Natural product-likeness | -1.132 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |