| General Information | |
|---|---|
| ZINC ID | ZINC000028569459 |
| Molecular Weight (Da) | 373 |
| SMILES | CCCCCCC(C)(C)c1cc(O)c([C@H]2C=C(C)CC[C@H]2C(C)C)c(O)c1 |
| Molecular Formula | C25O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.406 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| LogP | 8.129 |
| Activity (Ki) in nM | 123.027 |
| Polar Surface Area (PSA) | 40.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.05448365 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.68 |
| Ilogp | 3.92 |
| Xlogp3 | 8.55 |
| Wlogp | 7.44 |
| Mlogp | 5.25 |
| Silicos-it log p | 6.71 |
| Consensus log p | 6.37 |
| Esol log s | -7.17 |
| Esol solubility (mg/ml) | 0.000025 |
| Esol solubility (mol/l) | 6.71E-08 |
| Esol class | Poorly sol |
| Ali log s | -9.27 |
| Ali solubility (mg/ml) | 0.00000019 |
| Ali solubility (mol/l) | 5.33E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.59 |
| Silicos-it solubility (mg/ml) | 0.0000951 |
| Silicos-it solubility (mol/l) | 0.00000025 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.5 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.48 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.736 |
| Logd | 5.9 |
| Logp | 8.244 |
| F (20%) | 1 |
| F (30%) | 0.999 |
| Mdck | - |
| Ppb | 99.43% |
| Vdss | 9.176 |
| Fu | 2.54% |
| Cyp1a2-inh | 0.182 |
| Cyp1a2-sub | 0.815 |
| Cyp2c19-inh | 0.855 |
| Cyp2c19-sub | 0.892 |
| Cl | 3.077 |
| T12 | 0.058 |
| H-ht | 0.156 |
| Dili | 0.085 |
| Roa | 0.258 |
| Fdamdd | 0.923 |
| Skinsen | 0.866 |
| Ec | 0.025 |
| Ei | 0.766 |
| Respiratory | 0.86 |
| Bcf | 1.691 |
| Igc50 | 5.351 |
| Lc50 | 6.624 |
| Lc50dm | 6.726 |
| Nr-ar | 0.021 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.07 |
| Nr-aromatase | 0.732 |
| Nr-er | 0.739 |
| Nr-er-lbd | 0.949 |
| Nr-ppar-gamma | 0.121 |
| Sr-are | 0.86 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.758 |
| Sr-mmp | 0.993 |
| Sr-p53 | 0.421 |
| Vol | 430.878 |
| Dense | 0.864 |
| Flex | 0.667 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.367 |
| Synth | 3.613 |
| Fsp3 | 0.68 |
| Mce-18 | 54.238 |
| Natural product-likeness | 1.513 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |