| General Information | |
|---|---|
| ZINC ID | ZINC000028528537 |
| Molecular Weight (Da) | 494 |
| SMILES | C=C(c1ccccc1F)c1cc(Cl)ccc1S(=O)(=O)c1ccc([C@H](C)NS(C)(=O)=O)cc1 |
| Molecular Formula | C23Cl1F1N1O4S2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.983 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 5.128 |
| Activity (Ki) in nM | 245.471 |
| Polar Surface Area (PSA) | 97.07 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.07461118 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.13 |
| Ilogp | 2.59 |
| Xlogp3 | 5.41 |
| Wlogp | 7.24 |
| Mlogp | 4.38 |
| Silicos-it log p | 4.74 |
| Consensus log p | 4.87 |
| Esol log s | -6.27 |
| Esol solubility (mg/ml) | 2.68E-04 |
| Esol solubility (mol/l) | 5.43E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.2 |
| Ali solubility (mg/ml) | 3.09E-05 |
| Ali solubility (mol/l) | 6.26E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.33 |
| Silicos-it solubility (mg/ml) | 2.33E-07 |
| Silicos-it solubility (mol/l) | 4.72E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.47 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.809 |
| Logd | 2.741 |
| Logp | 4.572 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 2.04E-05 |
| Ppb | 0.9817 |
| Vdss | 0.473 |
| Fu | 0.0173 |
| Cyp1a2-inh | 0.474 |
| Cyp1a2-sub | 0.477 |
| Cyp2c19-inh | 0.928 |
| Cyp2c19-sub | 0.376 |
| Cl | 1.894 |
| T12 | 0.005 |
| H-ht | 0.968 |
| Dili | 0.996 |
| Roa | 0.515 |
| Fdamdd | 0.993 |
| Skinsen | 0.033 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.035 |
| Bcf | 0.65 |
| Igc50 | 4.442 |
| Lc50 | 4.355 |
| Lc50dm | 5.509 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.023 |
| Nr-ahr | 0.065 |
| Nr-aromatase | 0.022 |
| Nr-er | 0.071 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.186 |
| Sr-are | 0.751 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.008 |
| Sr-mmp | 0.89 |
| Sr-p53 | 0.012 |
| Vol | 458.784 |
| Dense | 1.075 |
| Flex | 23 |
| Nstereo | 0.304 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.503 |
| Fsp3 | 2.966 |
| Mce-18 | 0.13 |
| Natural product-likeness | 48 |
| Alarm nmr | -1.485 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Rejected |