| General Information | |
|---|---|
| ZINC ID | ZINC000028473060 |
| Molecular Weight (Da) | 560 |
| SMILES | C=CCN1C(=O)C(c2ccc(I)cc2)(c2ccc(I)cc2)NC1=S |
| Molecular Formula | C18I2N2O1S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.848 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| LogP | 5.178 |
| Activity (Ki) in nM | 588.844 |
| Polar Surface Area (PSA) | 64.43 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.05373644 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.11 |
| Ilogp | 3.53 |
| Xlogp3 | 4.86 |
| Wlogp | 3.17 |
| Mlogp | 3.74 |
| Silicos-it log p | 6.43 |
| Consensus log p | 4.35 |
| Esol log s | -6.48 |
| Esol solubility (mg/ml) | 0.000185 |
| Esol solubility (mol/l) | 0.00000033 |
| Esol class | Poorly sol |
| Ali log s | -5.95 |
| Ali solubility (mg/ml) | 0.000632 |
| Ali solubility (mol/l) | 0.00000113 |
| Ali class | Moderately |
| Silicos-it logsw | -7.6 |
| Silicos-it solubility (mg/ml) | 0.000014 |
| Silicos-it solubility (mol/l) | 0.00000002 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.27 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 3 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.79 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.863 |
| Logd | 3.818 |
| Logp | 5.577 |
| F (20%) | 0.018 |
| F (30%) | 0.024 |
| Mdck | - |
| Ppb | 98.80% |
| Vdss | 0.901 |
| Fu | 1.41% |
| Cyp1a2-inh | 0.248 |
| Cyp1a2-sub | 0.903 |
| Cyp2c19-inh | 0.801 |
| Cyp2c19-sub | 0.953 |
| Cl | 1.924 |
| T12 | 0.06 |
| H-ht | 0.047 |
| Dili | 0.934 |
| Roa | 0.048 |
| Fdamdd | 0.105 |
| Skinsen | 0.386 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.036 |
| Bcf | 2.18 |
| Igc50 | 4.858 |
| Lc50 | 5.582 |
| Lc50dm | 5.185 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.788 |
| Nr-aromatase | 0.068 |
| Nr-er | 0.652 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.181 |
| Sr-are | 0.851 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.362 |
| Sr-mmp | 0.865 |
| Sr-p53 | 0.855 |
| Vol | 370.333 |
| Dense | 1.512 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.349 |
| Synth | 2.909 |
| Fsp3 | 0.111 |
| Mce-18 | 39.9 |
| Natural product-likeness | -0.931 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |