| General Information | |
|---|---|
| ZINC ID | ZINC000028471252 |
| Molecular Weight (Da) | 544 |
| SMILES | C=CCN1C(=O)NC(c2ccc(I)cc2)(c2ccc(I)cc2)C1=O |
| Molecular Formula | C18I2N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 108.857 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| LogP | 4.279 |
| Activity (Ki) in nM | 1737.8 |
| Polar Surface Area (PSA) | 49.41 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.28856325 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.11 |
| Ilogp | 3.36 |
| Xlogp3 | 4.22 |
| Wlogp | 3.01 |
| Mlogp | 3.7 |
| Silicos-it log p | 4.98 |
| Consensus log p | 3.85 |
| Esol log s | -5.98 |
| Esol solubility (mg/ml) | 0.000572 |
| Esol solubility (mol/l) | 0.00000105 |
| Esol class | Moderately |
| Ali log s | -4.97 |
| Ali solubility (mg/ml) | 0.00586 |
| Ali solubility (mol/l) | 0.0000108 |
| Ali class | Moderately |
| Silicos-it logsw | -7.42 |
| Silicos-it solubility (mg/ml) | 0.0000207 |
| Silicos-it solubility (mol/l) | 3.81E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.62 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 3 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.57 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.727 |
| Logd | 3.947 |
| Logp | 5.158 |
| F (20%) | 0.005 |
| F (30%) | 0.015 |
| Mdck | - |
| Ppb | 97.76% |
| Vdss | 0.729 |
| Fu | 1.86% |
| Cyp1a2-inh | 0.197 |
| Cyp1a2-sub | 0.904 |
| Cyp2c19-inh | 0.79 |
| Cyp2c19-sub | 0.954 |
| Cl | 1.238 |
| T12 | 0.053 |
| H-ht | 0.065 |
| Dili | 0.928 |
| Roa | 0.045 |
| Fdamdd | 0.076 |
| Skinsen | 0.433 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.04 |
| Bcf | 1.134 |
| Igc50 | 4.143 |
| Lc50 | 5.318 |
| Lc50dm | 5.036 |
| Nr-ar | 0.021 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.656 |
| Nr-aromatase | 0.013 |
| Nr-er | 0.583 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.034 |
| Sr-are | 0.713 |
| Sr-atad5 | 0.015 |
| Sr-hse | 0.011 |
| Sr-mmp | 0.733 |
| Sr-p53 | 0.791 |
| Vol | 360.614 |
| Dense | 1.508 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.361 |
| Synth | 2.705 |
| Fsp3 | 0.111 |
| Mce-18 | 39.9 |
| Natural product-likeness | -1.035 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |