| General Information | |
|---|---|
| ZINC ID | ZINC000028342230 |
| Molecular Weight (Da) | 580 |
| SMILES | COc1ccc(S(=O)(=O)c2cc(OC)ccc2S(=O)(=O)c2ccc([C@H](C)NC(=O)Cc3ccccc3)cc2)cc1 |
| Molecular Formula | C30N1O7S2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 153.106 |
| HBA | 7 |
| HBD | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| LogP | 5.206 |
| Activity (Ki) in nM | 478.63 |
| Polar Surface Area (PSA) | 132.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.95892322 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.17 |
| Ilogp | 4.09 |
| Xlogp3 | 4.56 |
| Wlogp | 6.63 |
| Mlogp | 3.81 |
| Silicos-it log p | 4.61 |
| Consensus log p | 4.74 |
| Esol log s | -6.02 |
| Esol solubility (mg/ml) | 0.000547 |
| Esol solubility (mol/l) | 0.00000094 |
| Esol class | Poorly sol |
| Ali log s | -7.07 |
| Ali solubility (mg/ml) | 0.0000496 |
| Ali solubility (mol/l) | 8.56E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.62 |
| Silicos-it solubility (mg/ml) | 1.39E-08 |
| Silicos-it solubility (mol/l) | 2.40E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.6 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 2 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.17 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.461 |
| Logd | 3.241 |
| Logp | 4.147 |
| F (20%) | 0.002 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 99.29% |
| Vdss | 0.257 |
| Fu | 0.84% |
| Cyp1a2-inh | 0.072 |
| Cyp1a2-sub | 0.749 |
| Cyp2c19-inh | 0.808 |
| Cyp2c19-sub | 0.936 |
| Cl | 1.174 |
| T12 | 0.048 |
| H-ht | 0.911 |
| Dili | 0.998 |
| Roa | 0.008 |
| Fdamdd | 0.969 |
| Skinsen | 0.023 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.001 |
| Bcf | 0.286 |
| Igc50 | 4.297 |
| Lc50 | 3.792 |
| Lc50dm | 4.87 |
| Nr-ar | 0.043 |
| Nr-ar-lbd | 0.114 |
| Nr-ahr | 0.093 |
| Nr-aromatase | 0.02 |
| Nr-er | 0.44 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.653 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.002 |
| Sr-mmp | 0.724 |
| Sr-p53 | 0.001 |
| Vol | 568.483 |
| Dense | 1.019 |
| Flex | 0.379 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.287 |
| Synth | 2.779 |
| Fsp3 | 0.167 |
| Mce-18 | 56 |
| Natural product-likeness | -0.975 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |