| General Information | |
|---|---|
| ZINC ID | ZINC000028333649 |
| Molecular Weight (Da) | 446 |
| SMILES | O=C(c1cnc(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1)N1CCCCC1 |
| Molecular Formula | C23Cl3N2O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 118.731 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| LogP | 6.469 |
| Activity (Ki) in nM | 457.088 |
| Polar Surface Area (PSA) | 33.2 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.12322962 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.22 |
| Ilogp | 3.88 |
| Xlogp3 | 6.33 |
| Wlogp | 6.62 |
| Mlogp | 5.04 |
| Silicos-it log p | 6.86 |
| Consensus log p | 5.75 |
| Esol log s | -6.79 |
| Esol solubility (mg/ml) | 0.0000728 |
| Esol solubility (mol/l) | 0.00000016 |
| Esol class | Poorly sol |
| Ali log s | -6.82 |
| Ali solubility (mg/ml) | 0.0000679 |
| Ali solubility (mol/l) | 0.00000015 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.46 |
| Silicos-it solubility (mg/ml) | 0.00000015 |
| Silicos-it solubility (mol/l) | 3.48E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.52 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.97 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.743 |
| Logd | 4.025 |
| Logp | 6.259 |
| F (20%) | 0.004 |
| F (30%) | 0.014 |
| Mdck | - |
| Ppb | 99.88% |
| Vdss | 2.018 |
| Fu | 1.36% |
| Cyp1a2-inh | 0.663 |
| Cyp1a2-sub | 0.344 |
| Cyp2c19-inh | 0.758 |
| Cyp2c19-sub | 0.06 |
| Cl | 3.62 |
| T12 | 0.021 |
| H-ht | 0.422 |
| Dili | 0.946 |
| Roa | 0.594 |
| Fdamdd | 0.15 |
| Skinsen | 0.05 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.031 |
| Bcf | 3.9 |
| Igc50 | 5.249 |
| Lc50 | 6.424 |
| Lc50dm | 5.822 |
| Nr-ar | 0.049 |
| Nr-ar-lbd | 0.036 |
| Nr-ahr | 0.625 |
| Nr-aromatase | 0.872 |
| Nr-er | 0.42 |
| Nr-er-lbd | 0.068 |
| Nr-ppar-gamma | 0.265 |
| Sr-are | 0.846 |
| Sr-atad5 | 0.331 |
| Sr-hse | 0.56 |
| Sr-mmp | 0.835 |
| Sr-p53 | 0.821 |
| Vol | 422.191 |
| Dense | 1.052 |
| Flex | 0.16 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.435 |
| Synth | 2.118 |
| Fsp3 | 0.217 |
| Mce-18 | 51.857 |
| Natural product-likeness | -1.181 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |