| General Information | |
|---|---|
| ZINC ID | ZINC000028332749 |
| Molecular Weight (Da) | 461 |
| SMILES | O=C(NN1CCCCC1)c1cnc(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1 |
| Molecular Formula | C23Cl3N3O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.429 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 6.379 |
| Activity (Ki) in nM | 478.63 |
| Polar Surface Area (PSA) | 45.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.86007463 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.22 |
| Ilogp | 3.89 |
| Xlogp3 | 6.38 |
| Wlogp | 6.13 |
| Mlogp | 5 |
| Silicos-it log p | 6.07 |
| Consensus log p | 5.49 |
| Esol log s | -6.83 |
| Esol solubility (mg/ml) | 0.0000681 |
| Esol solubility (mol/l) | 0.00000014 |
| Esol class | Poorly sol |
| Ali log s | -7.12 |
| Ali solubility (mg/ml) | 0.0000348 |
| Ali solubility (mol/l) | 7.56E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.5 |
| Silicos-it solubility (mg/ml) | 0.00000014 |
| Silicos-it solubility (mol/l) | 3.19E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.58 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.25 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.785 |
| Logd | 4.367 |
| Logp | 5.803 |
| F (20%) | 0.007 |
| F (30%) | 0.289 |
| Mdck | - |
| Ppb | 100.32% |
| Vdss | 2.604 |
| Fu | 0.93% |
| Cyp1a2-inh | 0.515 |
| Cyp1a2-sub | 0.776 |
| Cyp2c19-inh | 0.838 |
| Cyp2c19-sub | 0.137 |
| Cl | 4.601 |
| T12 | 0.021 |
| H-ht | 0.706 |
| Dili | 0.958 |
| Roa | 0.695 |
| Fdamdd | 0.257 |
| Skinsen | 0.044 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.366 |
| Bcf | 3.345 |
| Igc50 | 5.162 |
| Lc50 | 6.56 |
| Lc50dm | 6.136 |
| Nr-ar | 0.041 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.917 |
| Nr-aromatase | 0.876 |
| Nr-er | 0.632 |
| Nr-er-lbd | 0.05 |
| Nr-ppar-gamma | 0.892 |
| Sr-are | 0.916 |
| Sr-atad5 | 0.549 |
| Sr-hse | 0.778 |
| Sr-mmp | 0.955 |
| Sr-p53 | 0.918 |
| Vol | 433.187 |
| Dense | 1.06 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.483 |
| Synth | 2.343 |
| Fsp3 | 0.217 |
| Mce-18 | 51.857 |
| Natural product-likeness | -1.163 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |