| General Information | |
|---|---|
| ZINC ID | ZINC000028126289 |
| Molecular Weight (Da) | 385 |
| SMILES | CC(=O)[C@@H](Sc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)c1ccccc1 |
| Molecular Formula | C24N2O1S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 115.391 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 5.385 |
| Activity (Ki) in nM | 7079.46 |
| Polar Surface Area (PSA) | 71.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.0640732 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.08 |
| Ilogp | 1.62 |
| Xlogp3 | 5.68 |
| Wlogp | 5.84 |
| Mlogp | 3.64 |
| Silicos-it log p | 6.19 |
| Consensus log p | 4.6 |
| Esol log s | -6.01 |
| Esol solubility (mg/ml) | 0.000372 |
| Esol solubility (mol/l) | 0.00000096 |
| Esol class | Poorly sol |
| Ali log s | -6.94 |
| Ali solubility (mg/ml) | 0.0000444 |
| Ali solubility (mol/l) | 0.00000011 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.22 |
| Silicos-it solubility (mg/ml) | 0.00000023 |
| Silicos-it solubility (mol/l) | 6.08E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.61 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.73 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.389 |
| Logd | 4.545 |
| Logp | 4.823 |
| F (20%) | 0.055 |
| F (30%) | 0 |
| Mdck | - |
| Ppb | 100.84% |
| Vdss | 0.585 |
| Fu | 1.07% |
| Cyp1a2-inh | 0.955 |
| Cyp1a2-sub | 0.432 |
| Cyp2c19-inh | 0.951 |
| Cyp2c19-sub | 0.055 |
| Cl | 10.042 |
| T12 | 0.179 |
| H-ht | 0.9 |
| Dili | 0.987 |
| Roa | 0.023 |
| Fdamdd | 0.052 |
| Skinsen | 0.769 |
| Ec | 0.004 |
| Ei | 0.828 |
| Respiratory | 0.948 |
| Bcf | 2.088 |
| Igc50 | 5.193 |
| Lc50 | 7.22 |
| Lc50dm | 6.172 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.544 |
| Nr-ahr | 0.733 |
| Nr-aromatase | 0.938 |
| Nr-er | 0.49 |
| Nr-er-lbd | 0.069 |
| Nr-ppar-gamma | 0.971 |
| Sr-are | 0.965 |
| Sr-atad5 | 0.139 |
| Sr-hse | 0.011 |
| Sr-mmp | 0.929 |
| Sr-p53 | 0.363 |
| Vol | 407.09 |
| Dense | 0.944 |
| Flex | 0.25 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.405 |
| Synth | 2.603 |
| Fsp3 | 0.083 |
| Mce-18 | 40 |
| Natural product-likeness | -0.889 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |