| General Information | |
|---|---|
| ZINC ID | ZINC000027761983 |
| Molecular Weight (Da) | 326 |
| SMILES | CC1=CC[C@@H]2[C@H](C1)c1c(O)cc(CC#CCCO)cc1OC2(C)C |
| Molecular Formula | C21O3 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 91.912 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| LogP | 4.537 |
| Activity (Ki) in nM | 446.684 |
| Polar Surface Area (PSA) | 49.69 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.71781939 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.52 |
| Ilogp | 3.55 |
| Xlogp3 | 5.25 |
| Wlogp | 4.01 |
| Mlogp | 3.43 |
| Silicos-it log p | 4.47 |
| Consensus log p | 4.14 |
| Esol log s | -5.22 |
| Esol solubility (mg/ml) | 0.00195 |
| Esol solubility (mol/l) | 0.00000597 |
| Esol class | Moderately |
| Ali log s | -6.04 |
| Ali solubility (mg/ml) | 0.000296 |
| Ali solubility (mol/l) | 0.0000009 |
| Ali class | Poorly sol |
| Silicos-it logsw | -4.64 |
| Silicos-it solubility (mg/ml) | 0.00748 |
| Silicos-it solubility (mol/l) | 0.0000229 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.56 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.26 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.773 |
| Logd | 4.056 |
| Logp | 5.581 |
| F (20%) | 0.985 |
| F (30%) | 0.949 |
| Mdck | - |
| Ppb | 94.69% |
| Vdss | 4.48 |
| Fu | 1.99% |
| Cyp1a2-inh | 0.728 |
| Cyp1a2-sub | 0.691 |
| Cyp2c19-inh | 0.963 |
| Cyp2c19-sub | 0.615 |
| Cl | 11.615 |
| T12 | 0.318 |
| H-ht | 0.946 |
| Dili | 0.048 |
| Roa | 0.164 |
| Fdamdd | 0.941 |
| Skinsen | 0.503 |
| Ec | 0.004 |
| Ei | 0.073 |
| Respiratory | 0.57 |
| Bcf | 1.475 |
| Igc50 | 4.285 |
| Lc50 | 4.928 |
| Lc50dm | 5.602 |
| Nr-ar | 0.039 |
| Nr-ar-lbd | 0.016 |
| Nr-ahr | 0.646 |
| Nr-aromatase | 0.591 |
| Nr-er | 0.204 |
| Nr-er-lbd | 0.3 |
| Nr-ppar-gamma | 0.639 |
| Sr-are | 0.698 |
| Sr-atad5 | 0.01 |
| Sr-hse | 0.524 |
| Sr-mmp | 0.895 |
| Sr-p53 | 0.677 |
| Vol | 356.655 |
| Dense | 0.915 |
| Flex | 0.118 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 4 |
| Qed | 0.639 |
| Synth | 3.885 |
| Fsp3 | 0.524 |
| Mce-18 | 62.938 |
| Natural product-likeness | 2.259 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |