| General Information | |
|---|---|
| ZINC ID | ZINC000027747543 |
| Molecular Weight (Da) | 405 |
| SMILES | CC1=CC[C@H]2[C@H](C1)c1c(O)cc(C/C=C/CCCBr)cc1OC2(C)C |
| Molecular Formula | C22Br1O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 110.126 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| LogP | 6.219 |
| Activity (Ki) in nM | 1.6596 |
| Polar Surface Area (PSA) | 29.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.987 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.55 |
| Ilogp | 4.28 |
| Xlogp3 | 7.3 |
| Wlogp | 6.28 |
| Mlogp | 4.85 |
| Silicos-it log p | 6.17 |
| Consensus log p | 5.78 |
| Esol log s | -6.8 |
| Esol solubility (mg/ml) | 0.0000643 |
| Esol solubility (mol/l) | 0.00000015 |
| Esol class | Poorly sol |
| Ali log s | -7.75 |
| Ali solubility (mg/ml) | 0.00000729 |
| Ali solubility (mol/l) | 0.00000001 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.42 |
| Silicos-it solubility (mg/ml) | 0.000154 |
| Silicos-it solubility (mol/l) | 0.00000038 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.59 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.37 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.812 |
| Logd | 4.739 |
| Logp | 7.378 |
| F (20%) | 0.944 |
| F (30%) | 0.986 |
| Mdck | - |
| Ppb | 99.81% |
| Vdss | 6.247 |
| Fu | 1.06% |
| Cyp1a2-inh | 0.433 |
| Cyp1a2-sub | 0.629 |
| Cyp2c19-inh | 0.859 |
| Cyp2c19-sub | 0.324 |
| Cl | 2.373 |
| T12 | 0.136 |
| H-ht | 0.909 |
| Dili | 0.45 |
| Roa | 0.234 |
| Fdamdd | 0.935 |
| Skinsen | 0.612 |
| Ec | 0.004 |
| Ei | 0.137 |
| Respiratory | 0.925 |
| Bcf | 2.926 |
| Igc50 | 4.961 |
| Lc50 | 6.045 |
| Lc50dm | 6.48 |
| Nr-ar | 0.017 |
| Nr-ar-lbd | 0.032 |
| Nr-ahr | 0.121 |
| Nr-aromatase | 0.186 |
| Nr-er | 0.26 |
| Nr-er-lbd | 0.516 |
| Nr-ppar-gamma | 0.416 |
| Sr-are | 0.699 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.863 |
| Sr-mmp | 0.906 |
| Sr-p53 | 0.683 |
| Vol | 387.081 |
| Dense | 1.044 |
| Flex | 0.294 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.355 |
| Synth | 3.886 |
| Fsp3 | 0.545 |
| Mce-18 | 62.588 |
| Natural product-likeness | 2.491 |
| Alarm nmr | 1 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |